|
|
| | 4-Butoxy-3-ethoxy-benzoic acid Basic information |
| | 4-Butoxy-3-ethoxy-benzoic acid Chemical Properties |
| form | solid | | InChI | 1S/C13H18O4/c1-3-5-8-17-11-7-6-10(13(14)15)9-12(11)16-4-2/h6-7,9H,3-5,8H2,1-2H3,(H,14,15) | | InChIKey | HEEGBVYBSCWQJP-UHFFFAOYSA-N | | SMILES | O(CCCC)c1c(cc(cc1)C(=O)O)OCC |
| Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 4-Butoxy-3-ethoxy-benzoic acid Usage And Synthesis |
| | 4-Butoxy-3-ethoxy-benzoic acid Preparation Products And Raw materials |
|