| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Butyl crotonate Basic information |
| Product Name: | Butyl crotonate | | Synonyms: | butyl2-butenoate;BUTYL T2 BUTENOATE;CROTONIC ACID BUTYL ESTER;CROTONIC ACID N-BUTYL ESTER;(E)-2-Butenoic acid butyl ester;2-butenoicacid,butylester;Butyl (2E)-2-butenoate;Butyl 2-butenoate | | CAS: | 7299-91-4 | | MF: | C8H14O2 | | MW: | 142.2 | | EINECS: | 230-742-2 | | Product Categories: | | | Mol File: | 7299-91-4.mol |  |
| | Butyl crotonate Chemical Properties |
| Boiling point | 180 °C | | density | 0.90 | | refractive index | 1.4320-1.4330 | | Fp | 64 °C | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C8H14O2/c1-3-5-7-10-8(9)6-4-2/h4,6H,3,5,7H2,1-2H3 | | InChIKey | GWCTUKHUBWMAMI-UHFFFAOYSA-N | | SMILES | C(OCCCC)(=O)C=CC | | LogP | 2.910 (est) |
| RTECS | GQ3200000 | | HS Code | 2916199590 |
| | Butyl crotonate Usage And Synthesis |
| Synthesis Reference(s) | The Journal of Organic Chemistry, 25, p. 1699, 1960 DOI: 10.1021/jo01080a003 |
| | Butyl crotonate Preparation Products And Raw materials |
|