- 1-Adamantaneethanol
-
- $0.00 / 1KG
-
2025-04-04
- CAS:6240-11-5
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1ton
- 1-Adamantaneethanol
-
- $1.00 / 1KG
-
2019-07-06
- CAS:6240-11-5
- Min. Order: 1KG
- Purity: 95%
- Supply Ability: 500kg
|
| | 1-Adamantaneethanol Basic information |
| | 1-Adamantaneethanol Chemical Properties |
| Melting point | 66-69 °C(lit.) | | Boiling point | 253.13°C (rough estimate) | | density | 0.9003 (rough estimate) | | refractive index | 1.5050 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | Water Solubility | Insoluble in water | | pka | 15.32±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | BRN | 1855382 | | Stability: | Stable. Incompatible with strong oxidizing agents, strong acids, acid halides. | | InChI | InChI=1S/C12H20O/c13-2-1-12-6-9-3-10(7-12)5-11(4-9)8-12/h9-11,13H,1-8H2 | | InChIKey | ZBIDZPHRNBZTLT-UHFFFAOYSA-N | | SMILES | C12(CCO)CC3CC(CC(C3)C1)C2 | | CAS DataBase Reference | 6240-11-5(CAS DataBase Reference) | | NIST Chemistry Reference | 1-Adamantaneethanol(6240-11-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-36-26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29061990 | | Storage Class | 11 - Combustible Solids |
| | 1-Adamantaneethanol Usage And Synthesis |
| Chemical Properties | white or cream solid | | Uses | 1-Adamantaneethanol was used in the synthesis of:
- 4-(adamant-1-ylethylenoxycarbonyl)phthalanhydride
- poly(2-methoxy-5-cyclohexylmethyloxy-p-phenylene vinylene)
- adamantine-containing phthalocyanines
|
| | 1-Adamantaneethanol Preparation Products And Raw materials |
|