| Company Name: |
Hu Bei Jiutian Bio-medical Technology CO.,Ltd |
| Tel: |
027-88013699 17354350817 |
| Email: |
Ryan@jiutian-bio.com |
| Products Intro: |
Product Name:2H-Pyran-6-carboxylicacid, 3,4-dihydro-2,2-dimethyl-4-oxo-
CAS:80866-93-9
Purity:0.99 Package:25kg,50kg,180kg,200kg,250kg,1000kg,as your needs Remarks:as your needs
|
|
|
|
|
3,4-DIHYDRO-2,2-DIMETHYL-4-OXO-2H-PYRAN-6-CARBOXYLIC ACID manufacturers
|
| | 3,4-DIHYDRO-2,2-DIMETHYL-4-OXO-2H-PYRAN-6-CARBOXYLIC ACID Basic information |
| Product Name: | 3,4-DIHYDRO-2,2-DIMETHYL-4-OXO-2H-PYRAN-6-CARBOXYLIC ACID | | Synonyms: | 3,4-dihydro-2,2-dimethyl-4-oxo-2h-pyran-6-carboxylicaci;5,6-dihydro-6,6-dimethyl-4-oxo-4h-pyran-2-carboxylicaci;5,6-dihydro-6,6-dimethyl-4-oxo-4h-pyran-2-carboxylicacid;acidedimethyl-6,6dihydro-5,6pyrone-4carboxylique-2;3,4-DIHYDRO-2,2-DIMETHYL-4-OXO-2H-PYRAN-6-CARBOXYLIC;3,4-DIHYDRO-2,2-DIMETHYL-4-OXO-2H-PYRAN-6-CARBOXYLIC ACID;4-Oxo-6,6-dimethyl-5,6-dihydro-4H-pyran-2-carboxylic acid;3,4-Dihydro-2,2-dimethyl-4-oxo-2H-pyran-6-carboxylic acid,98% | | CAS: | 80866-93-9 | | MF: | C8H10O4 | | MW: | 170.16 | | EINECS: | 279-596-1 | | Product Categories: | Building Blocks;Heterocyclic Building Blocks;Pyrans | | Mol File: | 80866-93-9.mol |  |
| | 3,4-DIHYDRO-2,2-DIMETHYL-4-OXO-2H-PYRAN-6-CARBOXYLIC ACID Chemical Properties |
| Melting point | 170 °C (dec.) (lit.) | | Boiling point | 219.79°C (rough estimate) | | density | 1.1456 (rough estimate) | | refractive index | 1.4425 (estimate) | | InChI | InChI=1S/C8H10O4/c1-8(2)4-5(9)3-6(12-8)7(10)11/h3H,4H2,1-2H3,(H,10,11) | | InChIKey | ANKQOBXQEHGUJT-UHFFFAOYSA-N | | SMILES | C1(C)(C)OC(C(O)=O)=CC(=O)C1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36 | | WGK Germany | 3 | | RTECS | UP6990000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3,4-DIHYDRO-2,2-DIMETHYL-4-OXO-2H-PYRAN-6-CARBOXYLIC ACID Usage And Synthesis |
| Chemical Properties | white to beige fine crystalline powder | | Uses | 3,4-Dihydro-2,2-dimethyl-4-oxo-2H-pyran-6-carboxylic acid was used as photoprotective reagent during photolysis of the Salmonella sialidase. | | General Description | Butyl ester of 3,4-dihydro-2,2-dimethyl-4-oxo-2H-pyran-6-carboxylic acid is commonly used as mosquito repellent. |
| | 3,4-DIHYDRO-2,2-DIMETHYL-4-OXO-2H-PYRAN-6-CARBOXYLIC ACID Preparation Products And Raw materials |
|