|
|
| | 5-Bromo-3-methylpyridine-2-carboxylic acid methyl ester Basic information |
| Product Name: | 5-Bromo-3-methylpyridine-2-carboxylic acid methyl ester | | Synonyms: | 5-BroMo-3-Methylpyridine-2-Carboxylic Acid Methyl;5-Bromo-3-methylpicolinic acid methyl ester;methyl 3-methyl-5-bromo-2-pyridinecarboxylate;Methyl 5-bromo-3-methylpicolinate, 5-Bromo-2-(methoxycarbonyl)-3-methylpyridine;2-Pyridinecarboxylic acid, 5-bromo-3-methyl-, methyl ester;Methyl 5-Bromo-3-methylpicolinate;Methyl 5-bromo-3-methyl-pyridine-2-carboxylate;5-Bromo-3-methylpyridine-2-carboxylic acid methyl ester ISO 9001：2015 REACH | | CAS: | 213771-32-5 | | MF: | C8H8BrNO2 | | MW: | 230.06 | | EINECS: | | | Product Categories: | Heterocycle-Pyridine series | | Mol File: | 213771-32-5.mol |  |
| | 5-Bromo-3-methylpyridine-2-carboxylic acid methyl ester Chemical Properties |
| Boiling point | 302.2±37.0 °C(Predicted) | | density | 1.503 | | storage temp. | Inert atmosphere,Room Temperature | | pka | -0.17±0.10(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C8H8BrNO2/c1-5-3-6(9)4-10-7(5)8(11)12-2/h3-4H,1-2H3 | | InChIKey | KZPOANNAYCXMSH-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)=NC=C(Br)C=C1C |
| | 5-Bromo-3-methylpyridine-2-carboxylic acid methyl ester Usage And Synthesis |
| Synthesis | Step C: Synthesis of methyl 5-bromo-3-methylpyridine-2-carboxylate
5-Bromo-3-methylpyridine-2-carboxylic acid (2.6 g, 12 mmol) was dissolved in N,N-dimethylformamide (20.0 mL) followed by addition of potassium carbonate (4.99 g, 36.1 mmol) and iodomethane (1.50 mL, 24.1 mmol). The reaction mixture was stirred at 80 °C for 40 min. After completion of the reaction, the mixture was extracted with ethyl acetate and water by partitioning. The organic layer was separated, washed with saturated brine, dried over anhydrous sodium sulfate, filtered and concentrated to give methyl 5-bromo-3-methylpyridine-2-carboxylate 2.3 g in yellow solid form in 83% yield. | | References | [1] Patent: US2013/96144, 2013, A1. Location in patent: Paragraph 0392; 0393
[2] Patent: WO2008/100715, 2008, A1. Location in patent: Page/Page column 34 |
| | 5-Bromo-3-methylpyridine-2-carboxylic acid methyl ester Preparation Products And Raw materials |
|