- Styrenated Phenol
-
- $5.00
-
2026-05-28
- CAS:61788-44-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000kg
|
| | Styrenated phenol Basic information |
| | Styrenated phenol Chemical Properties |
| Boiling point | >250℃ | | density | 1.08g/cm3 | | vapor pressure | 0.1Pa at 20℃ | | refractive index | 1.5785~1.6020 | | Fp | 182℃ | | storage temp. | Storage temp. 2-8°C | | solubility | 1000g/L in organic solvents at 20 ℃ | | pka | 0[at 20 ℃] | | Appearance | Colorless to light yellow Liquid | | Water Solubility | 1.95mg/L at 22℃ | | InChI | InChI=1S/C30H30O/c1-21(24-13-7-4-8-14-24)27-19-28(22(2)25-15-9-5-10-16-25)30(31)29(20-27)23(3)26-17-11-6-12-18-26/h4-23,31H,1-3H3 | | InChIKey | BYLSIPUARIZAHZ-UHFFFAOYSA-N | | SMILES | C1=C(C=C(C(C2C=CC=CC=2)C)C(O)=C1C(C1C=CC=CC=1)C)C(C1C=CC=CC=1)C | | LogP | 3.03 at 23.6℃ | | EPA Substance Registry System | Styrenated phenol (61788-44-1) |
| | Styrenated phenol Usage And Synthesis |
| Chemical Properties | Light yellow to amber viscous liquid. Soluble in ethanol, acetone, aliphatic hydrocarbons, aromatic hydrocarbons, trichloroethane and other organic solvents, insoluble in water. | | Uses | MSP is a styrenated phenol with a high mono ratio of 75% | | Uses | Tri-Styrylphenol offers multifunctional applications depending on the mono/para ratio | | Flammability and Explosibility | Non flammable |
| | Styrenated phenol Preparation Products And Raw materials |
|