|
|
| | (2R,5R)-2,5-HEXANEDIOL Basic information |
| Product Name: | (2R,5R)-2,5-HEXANEDIOL | | Synonyms: | (2R,5R)-(-)-2,5-HEXANEDIOL;(2R,5R)-2,5-HEXANEDIOL;(2R,5R)-2,5-DIHYDROXYHEXANE;(2R,5R)-DIHYDROXYHEXANE;(2R,5R)-HEXANE-2,5-DIOL;Hexanediolcolorlessxtl;(2R,5R)-2,5-Hezanediol;(2R,5R)-(-)-2,5-Hexanediol,99% | | CAS: | 17299-07-9 | | MF: | C6H14O2 | | MW: | 118.17 | | EINECS: | | | Product Categories: | Chiral Compounds;Diols;organic alcohol;Chiral Building Blocks;Simple Alcohols (Chiral);Synthetic Organic Chemistry;Chiral Building Blocks;Organic Building Blocks;Polyols | | Mol File: | 17299-07-9.mol |  |
| | (2R,5R)-2,5-HEXANEDIOL Chemical Properties |
| Melting point | 52-54 °C | | alpha | -39.6° (c 1, CHCl3) | | Boiling point | 212-215 °C | | density | 0.9843 (rough estimate) | | refractive index | 1.4428 (estimate) | | Fp | 101 °C | | storage temp. | 2-8°C | | solubility | almost transparency in Methanol | | pka | 14.87±0.20(Predicted) | | form | Crystalline Powder or Needles | | color | White to yellow | | Optical Rotation | [α]20/D 35±2°, c = 9% in chloroform | | BRN | 1719251 | | InChI | InChI=1S/C6H14O2/c1-5(7)3-4-6(2)8/h5-8H,3-4H2,1-2H3/t5-,6-/m1/s1 | | InChIKey | OHMBHFSEKCCCBW-PHDIDXHHSA-N | | SMILES | C[C@@H](O)CC[C@H](O)C | | CAS DataBase Reference | 17299-07-9(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 3-10 | | HS Code | 2905399590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (2R,5R)-2,5-HEXANEDIOL Usage And Synthesis |
| Chemical Properties | white to yellow needle-like crystals | | Definition | ChEBI: (2R,5R)-hexanediol is a hexane-2,5-diol with R-configuration at both the C-2 and C-5 centres. |
| | (2R,5R)-2,5-HEXANEDIOL Preparation Products And Raw materials |
|