- 1,4-Benzodioxan
-
- $60.00 / 1KG
-
2025-12-12
- CAS:493-09-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200000KG
- 1,4-Benzodioxan
-
- $0.00 / 25kg
-
2025-12-01
- CAS:493-09-4
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
- 1,4-Benzodioxane
-
- $15.00 / 1KG
-
2021-07-13
- CAS:493-09-4
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 1,4-Benzodioxan Basic information |
| Product Name: | 1,4-Benzodioxan | | Synonyms: | 1,2-Ethylenedioxybenzene, 1,4-Benzodioxan, 2,3-Dihydro-1,4-benzodioxin;1,4-Benzodioxan,99%;(R)-1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol;2,3-dihydrobenzo[b][1,4]dioxine 2,3-dihydro-1,4-benzodioxine;2-benzyl-1,4-dioxane;1,4-Benzodioxan, 99% 25ML;2,3-Dihydro-1,4-benzodioxin
1,2-Ethylenedioxybenzene;1,4-Benzodioxane, 1,2-(Ethylenedioxy)benzene | | CAS: | 493-09-4 | | MF: | C8H8O2 | | MW: | 136.15 | | EINECS: | 207-775-6 | | Product Categories: | Miscellaneous Compounds | | Mol File: | 493-09-4.mol |  |
| | 1,4-Benzodioxan Chemical Properties |
| Melting point | 213-217 °C | | Boiling point | 103 °C6 mm Hg(lit.) | | density | 1.142 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.549(lit.) | | Fp | 190 °F | | storage temp. | Sealed in dry,Room Temperature | | form | Liquid | | Specific Gravity | 1.142 | | color | Clear colorless to light yellow | | Water Solubility | insoluble | | BRN | 120846 | | InChI | InChI=1S/C8H8O2/c1-2-4-8-7(3-1)9-5-6-10-8/h1-4H,5-6H2 | | InChIKey | BNBQRQQYDMDJAH-UHFFFAOYSA-N | | SMILES | O1C2=CC=CC=C2OCC1 | | CAS DataBase Reference | 493-09-4(CAS DataBase Reference) | | NIST Chemistry Reference | 1,4-Dioxatetralin(493-09-4) | | EPA Substance Registry System | 1,4-Benzodioxin, 2,3-dihydro- (493-09-4) |
| Hazard Codes | Xi | | Safety Statements | 23-24/25 | | WGK Germany | 3 | | RTECS | DF4728000 | | Hazard Note | Irritant | | HS Code | 29329995 |
| | 1,4-Benzodioxan Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS TO VERY SLIGHTLY YELLOW LIQUID | | Uses | Benzo-1,4-dioxane (2,3-dihydro-1,4-benzodioxin) is used in the synthesis of stereoisomers which were evaluated as α- and β- adrenergic antagonists | | General Description | The anti-inflammamtory properties and synthesis of carboxylic acid compounds containing benzo-1,4-dioxane (2,3-dihydro-1,4-benzodioxin) subunit was studied. |
| | 1,4-Benzodioxan Preparation Products And Raw materials |
| Raw materials | 2-hydroxyphenyl 2-chloroethyl ether-->2,3-DIBROMO-BENZO-1,4-DIOXANE-->O,O'-BIS(2-HYDROXYETHOXY)BENZENE-->2-(2-HYDROXYETHOXY)PHENOL-->3,4-ETHYLENEDIOXYIODOBENZENE-->Ethanol, 2-(2-broMophenoxy)--->2-(4-Iodo-phenoxy)-ethanol-->2-(2-Fluoro-phenoxy)-ethanol-->2-HYDROXYMETHYL-1,4-BENZODIOXANE-->2-Fluorophenol-->2-Bromophenol-->2-Phenoxyethanol | | Preparation Products | 1,4-Benzodioxane-6-boronic acid-->6-BROMO-1,4-BENZODIOXANE-->1,4-BENZODIOXAN-6-CARBOXALDEHYDE-->3,4-Dihydroxybenzophenone-->R-(+)-6,6'-BIS(DIPHENYLPHOSPHINO)-2,2',3,3'-TETRAHYDRO-5,5'-BI-1,4-BENZODIOXIN |
|