|
|
| | N-Hydroxysulfosuccinimide sodium salt Basic information |
| | N-Hydroxysulfosuccinimide sodium salt Chemical Properties |
| Melting point | 250 °C (dec.)(lit.) | | storage temp. | Inert atmosphere,2-8°C | | solubility | Methanol, Water (Slightly) | | form | Powder | | color | White | | Water Solubility | Soluble in methanol and water. | | BRN | 6359129 | | Major Application | peptide synthesis | | InChI | InChI=1S/C4H5NO6S.Na.H/c6-3-1-2(12(9,10)11)4(7)5(3)8;;/h2,8H,1H2,(H,9,10,11);; | | InChIKey | ZNUUAMSMZNYKLZ-UHFFFAOYSA-N | | SMILES | S(C1CC(=O)N(O)C1=O)(O)(=O)=O.[NaH] | | CAS DataBase Reference | 106627-54-7(CAS DataBase Reference) |
| | N-Hydroxysulfosuccinimide sodium salt Usage And Synthesis |
| Description | Sulfo-NHS is used during the modificaiton of carboxylic groups to NHS ester groups. This can be used for crosslinking, labeling and other biological techniques. | | Chemical Properties | White Crystalline Solid | | Uses | N-Hydroxysulfosuccinimide Sodium Salt is a hydrophilic ligand for the preparation of active esters, which can be used for crosslinking agents. | | Uses | trifunctional amine and sulfhydryl reactive cross-linking reagent | | Uses | Sulfo-NHS is used for preparing hydrophilic active esters, e.g. for crosslinking agents. | | reaction suitability | reaction type: Addition Reactions | | IC 50 | Non-cleavable Linker |
| | N-Hydroxysulfosuccinimide sodium salt Preparation Products And Raw materials |
|