|
|
| | 4-Benzoyl-1H-pyrrole-2-carboxamide Basic information |
| | 4-Benzoyl-1H-pyrrole-2-carboxamide Chemical Properties |
| Melting point | 230-232°C | | Boiling point | 461.3±30.0 °C(Predicted) | | density | 1.301±0.06 g/cm3(Predicted) | | pka | 14.00±0.50(Predicted) | | form | solid | | InChI | 1S/C12H10N2O2/c13-12(16)10-6-9(7-14-10)11(15)8-4-2-1-3-5-8/h1-7,14H,(H2,13,16) | | InChIKey | XQAPLOZSRLYHGQ-UHFFFAOYSA-N | | SMILES | NC(=O)c1cc(c[nH]1)C(=O)c2ccccc2 |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 4-Benzoyl-1H-pyrrole-2-carboxamide Usage And Synthesis |
| | 4-Benzoyl-1H-pyrrole-2-carboxamide Preparation Products And Raw materials |
|