- Bumetanide Impurity 10
-
- $0.00 / 10mg
-
2026-01-22
- CAS:22892-96-2
- Min. Order: 10mg
- Purity: 0.98
- Supply Ability: 10g
- Bumetanide Impurity 10
-
- $0.00 / 10mg
-
2026-01-22
- CAS:22892-96-2
- Min. Order: 10mg
- Purity: 0.98
- Supply Ability: 10g
|
| | 4-Chloro-3-nitro-5-sulphamoylbenzoic acid Basic information |
| | 4-Chloro-3-nitro-5-sulphamoylbenzoic acid Chemical Properties |
| Melting point | 227-231 °C | | Boiling point | 563.5±60.0 °C(Predicted) | | density | 1.814±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 2.82±0.10(Predicted) | | color | Off-White to Light Beige | | InChI | InChI=1S/C7H5ClN2O6S/c8-6-4(10(13)14)1-3(7(11)12)2-5(6)17(9,15)16/h1-2H,(H,11,12)(H2,9,15,16) | | InChIKey | ACYLUAGCBGTEJF-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC([N+]([O-])=O)=C(Cl)C(S(N)(=O)=O)=C1 | | CAS DataBase Reference | 22892-96-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2935909097 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Chloro-3-nitro-5-sulphamoylbenzoic acid Usage And Synthesis |
| Uses | Intermediate in the production of Bumetanide | | Uses | 4-Chloro-3-nitro-5-sulfamoylbenzoic acid has been used in preparation of 4-((2-(2-hydroxyphenyl)quinolin-3-yl)methylamino)-3-nitro-5-sulfamoylbenzoic acid. |
| | 4-Chloro-3-nitro-5-sulphamoylbenzoic acid Preparation Products And Raw materials |
|