|
| 3,4,5-TRIFLUOROBENZYL BROMIDE Basic information |
Product Name: | 3,4,5-TRIFLUOROBENZYL BROMIDE | Synonyms: | 5-(BROMOMETHYL)-1,2,3-TRIFLUOROBENZENE;ALPHA-BROMO-3,4,5-TRIFLUOROTOLUENE;3,4,5-TRIFLUOROBENZYL BROMIDE;à-bromo-3,4,5-trifluorotoluene;3,4,5-Trifluorobenzyl bromide 98%;3,4,5-Trifluorobenzylbromide98%;A-BROMO-3,4,5-TRIFLUOROTOLUENE;-bromo-3,4,5-trifluorotoluene | CAS: | 220141-72-0 | MF: | C7H4BrF3 | MW: | 225.01 | EINECS: | | Product Categories: | Aromatic Halides (substituted);Aryl;C7;Halogenated Hydrocarbons | Mol File: | 220141-72-0.mol |  |
| 3,4,5-TRIFLUOROBENZYL BROMIDE Chemical Properties |
Boiling point | 44-46°C 1mm | density | 1.689 g/mL at 25 °C (lit.) | refractive index | n20/D 1.5050(lit.) | Fp | 150 °F | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | form | clear liquid | color | Light yellow to Brown | Sensitive | Lachrymatory | BRN | 8680985 | InChI | InChI=1S/C7H4BrF3/c8-3-4-1-5(9)7(11)6(10)2-4/h1-2H,3H2 | InChIKey | MPEKZIYOLQCWLL-UHFFFAOYSA-N | SMILES | C1(F)=CC(CBr)=CC(F)=C1F | CAS DataBase Reference | 220141-72-0(CAS DataBase Reference) |
Hazard Codes | C | Risk Statements | 34 | Safety Statements | 26-27-36/37/39-45 | RIDADR | UN 1760 8/PG 3 | WGK Germany | 3 | Hazard Note | Corrosive/Lachrymatory | TSCA | T | HazardClass | 8 | PackingGroup | II | HS Code | 29039990 |
| 3,4,5-TRIFLUOROBENZYL BROMIDE Usage And Synthesis |
Chemical Properties | Colorless liquid |
| 3,4,5-TRIFLUOROBENZYL BROMIDE Preparation Products And Raw materials |
|