| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
Matrix Scientific |
| Tel: |
803 788-9494 All other calls |
| Email: |
sales@matrixscientific.com |
|
| | 1-Cyclopentylpiperidine-4-carboxylic acidhydrochloride Basic information |
| | 1-Cyclopentylpiperidine-4-carboxylic acidhydrochloride Chemical Properties |
| form | solid | | InChI | 1S/C11H19NO2.ClH/c13-11(14)9-5-7-12(8-6-9)10-3-1-2-4-10;/h9-10H,1-8H2,(H,13,14);1H | | InChIKey | JLFACGVVEAOMKX-UHFFFAOYSA-N | | SMILES | Cl.OC(=O)C1CCN(CC1)C2CCCC2 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1-Cyclopentylpiperidine-4-carboxylic acidhydrochloride Usage And Synthesis |
| | 1-Cyclopentylpiperidine-4-carboxylic acidhydrochloride Preparation Products And Raw materials |
|