- 2,6-DIMETHYLPIPERAZINE
-
- $1.10 / 1g
-
2025-11-18
- CAS:21655-48-1
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons
- 2,6-DIMETHYLPIPERAZINE
-
- $10.00 / 1KG
-
2021-10-19
- CAS:21655-48-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20 Tons
|
| | cis-2,6-Dimethylpiperazine Basic information |
| Product Name: | cis-2,6-Dimethylpiperazine | | Synonyms: | cis-2,6-DiMethylpiperazine , 98.0%(GC&T;2,6DIMETHYLPIPRAZINE;cis-2,6-Dimethylpiperazine;cis-2,6-Dimethylpiperazine 98+%;2,6-Dimethylpiperazi;(2S,6R)-rel-2,6-DiMethylpiperazine;cis-3,5-DiMethylpiperazine;Piperazine,2,6-diMethyl-, (2R,6S)-rel- | | CAS: | 21655-48-1 | | MF: | C6H14N2 | | MW: | 114.19 | | EINECS: | 606-812-7 | | Product Categories: | | | Mol File: | 21655-48-1.mol |  |
| | cis-2,6-Dimethylpiperazine Chemical Properties |
| Melting point | 108-111 °C(lit.) | | Boiling point | 162 °C(lit.) | | density | 0.9140 (estimate) | | refractive index | 1.4628 (estimate) | | Fp | 113 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | Water Solubility | Completely soluble in water | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | pka | 9.38±0.60(Predicted) | | form | powder to crystal | | color | White to Orange to Green | | Sensitive | Light Sensitive & Hygroscopic | | InChI | InChI=1/C6H14N2/c1-5-3-7-4-6(2)8-5/h5-8H,3-4H2,1-2H3/t5-,6+ | | InChIKey | IFNWESYYDINUHV-OLQVQODUNA-N | | SMILES | C[C@@H]1CNC[C@@H](N1)C |&1:1,5,r| | | CAS DataBase Reference | 21655-48-1(CAS DataBase Reference) |
| | cis-2,6-Dimethylpiperazine Usage And Synthesis |
| Chemical Properties | Pale Yellow to Light Yellow Solid. | | Uses | cis-2,6-Dimethylpiperazine is a very versatile reagent used in the preparation of biologically active compounds such as antibacterial agents. | | Synthesis | A method for the synthesis of cis-2,6-dimethylpiperazine:diisopropanolamine reacts with ammonia in the presence of a catalyst.
 | | Solubility in water | Completely soluble. |
| | cis-2,6-Dimethylpiperazine Preparation Products And Raw materials |
|