| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Methyl-3-nitrophenol Basic information |
| | 4-Methyl-3-nitrophenol Chemical Properties |
| Melting point | 78-81 °C (lit.) | | Boiling point | 266.03°C (rough estimate) | | density | 1.2744 (estimate) | | vapor pressure | 0.084Pa at 25℃ | | refractive index | 1.5744 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Ethyl Acetate, Methanol | | form | Powder | | pka | 8.66±0.10(Predicted) | | color | Pale Yellow Crystalline | | Water Solubility | Slightly soluble in water. | | Cosmetics Ingredients Functions | HAIR DYEING | | InChI | InChI=1S/C7H7NO3/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4,9H,1H3 | | InChIKey | BQEXDUKMTVYBRK-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(C)C([N+]([O-])=O)=C1 | | LogP | 2.18 at 25℃ | | CAS DataBase Reference | 2042-14-0(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Methyl-3-nitrophenol(2042-14-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-36 | | RIDADR | 2446 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29089990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Methyl-3-nitrophenol Usage And Synthesis |
| Chemical Properties | Pale Yellow Crystalline Solid | | Uses | 3-Nitro-4-methylphenol (cas# 2042-14-0) is a compound useful in organic synthesis. | | Synthesis Reference(s) | Synthesis, p. 735, 1986 DOI: 10.1055/s-1986-31759 | | Synthesis | General procedure for the synthesis of 4-methyl-3-nitrophenol from 4-methyl-3-nitroaniline: 4-methyl-3-nitroaniline (200 mg, 1.31 mmol) was dissolved in a 3:1 mixture of H2SO4-H2O. The resulting mixture was heated to 100 °C and kept for 30 min. Upon completion of the reaction, the reaction mixture was cooled to 0 °C and NaNO2 solution was added slowly and dropwise. After the dropwise addition was completed, the reaction was continued for 1 hour, after which the mixture was heated to reflux. After the reaction was complete, the reaction mixture was extracted several times with EtOAc, the organic phases were combined and dried with anhydrous Na2SO4, and subsequently concentrated. The crude product was purified by fast column chromatography (eluent ratio: petroleum ether-ethyl acetate 9:1) to give a yellow solid in 70% yield. The structure of the product was confirmed by 1H NMR (400 MHz, CDCl3): δ 7.48 (s, 1H), 7.17 (d, J = 8.4 Hz, 1H), 7.01 (dd, J = 8.4, 2.4 Hz, 1H), 5.84 (s, 1H), 2.48 (s, 3H) ppm. | | References | [1] Chemistry - A European Journal, 2009, vol. 15, # 12, p. 2742 - 2746 [2] Patent: WO2016/128541, 2016, A1. Location in patent: Page/Page column 92; 93 [3] Patent: WO2017/162834, 2017, A1. Location in patent: Page/Page column 85 [4] Justus Liebigs Annalen der Chemie, 1882, vol. 215, p. 83 [5] Chemische Berichte, 1882, vol. 15, p. 2992 |
| | 4-Methyl-3-nitrophenol Preparation Products And Raw materials |
|