|
|
| | 1,2-DIIODOTETRAFLUOROBENZENE Basic information |
| Product Name: | 1,2-DIIODOTETRAFLUOROBENZENE | | Synonyms: | 1,2-DIIODOTETRAFLUOROBENZENE;1,2,3,4-tetrafluoro-5,6-diiodobenzene;1-bromo-4-[1-(4-bromophenyl)-2-methylprop-1-enyl]benzene;1,2-Diiodotetrafluorobenzene 99%;1,2-Diiodotetrafluorobenzene99%;1 2-DIIODOTERAFLUOROBENZENE;1,2-Diiodo-3,4,5,6-tetrafluorobenzene;Tetrafluoro-1,2-phenylene diiodide | | CAS: | 2708-97-6 | | MF: | C6F4I2 | | MW: | 401.87 | | EINECS: | 220-303-3 | | Product Categories: | Aryl;Halogenated Hydrocarbons;C6 | | Mol File: | 2708-97-6.mol |  |
| | 1,2-DIIODOTETRAFLUOROBENZENE Chemical Properties |
| Melting point | 49-50 °C (lit.) | | Boiling point | 232.6±40.0 °C(Predicted) | | density | 2.671±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | form | crystalline solid | | color | Off-white to faint yellow | | InChI | InChI=1S/C6F4I2/c7-1-2(8)4(10)6(12)5(11)3(1)9 | | InChIKey | JQBYIZAYQMMVTO-UHFFFAOYSA-N | | SMILES | C1(F)=C(I)C(I)=C(F)C(F)=C1F | | CAS DataBase Reference | 2708-97-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29039990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,2-DIIODOTETRAFLUOROBENZENE Usage And Synthesis |
| Uses | 1,2,3,4-Tetrafluoro-5,6-diiodobenzene is used in perfluorinated graded index polymer optical fiber as a dopant. | | General Description | 1,2-Diiodotetrafluorobenzene on treatment with methyl lithium at -78/dg, affords dilithiotetrafluorobenzene. 1,2-Diiodotetrafluorobenzene (1,2-DITFB) forms co-crystals with nitroxide 1,1,3,3-tetramethylisoindolin-2-yloxyl (TMIO), a 2:2 cyclic tetramer, (TMIO)2·(1,2-DITFB)2. |
| | 1,2-DIIODOTETRAFLUOROBENZENE Preparation Products And Raw materials |
| Raw materials | 1-chloro-2,3,4,5-tetrafluoro-6-(trifluoromethyl)benzene-->Benzene, 1-chloro-2,3,4,5-tetrafluoro--->2-AMINO-3,4,5,6-TETRAFLUOROBENZOIC ACID-->Sulfuric acid-->1,2,3,4-Tetrafluorobenzene-->Sulfur trioxide-->Iodine |
|