|
|
| | Phosphoenolpyruvic acid cyclohexylammonium salt Basic information |
| | Phosphoenolpyruvic acid cyclohexylammonium salt Chemical Properties |
| Melting point | 140°C | | density | 1.36 g/cm3 | | storage temp. | -20°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | powder to crystal | | color | White to Almost white | | Stability: | Hygroscopic | | InChI | InChI=1S/C6H13N.C3H5O6P/c7-6-4-2-1-3-5-6;1-2(3(4)5)9-10(6,7)8/h6H,1-5,7H2;1H2,(H,4,5)(H2,6,7,8) | | InChIKey | VHFCNZDHPABZJO-UHFFFAOYSA-N | | SMILES | O(P(O)(=O)O)C(=C)C(=O)O.C1CCCCC1N | | CAS DataBase Reference | 10526-80-4(CAS DataBase Reference) | | EPA Substance Registry System | 2-Propenoic acid, 2-(phosphonooxy)-, compd. with cyclohexanamine (1:1) (10526-80-4) |
| Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29213000 | | Storage Class | 11 - Combustible Solids |
| | Phosphoenolpyruvic acid cyclohexylammonium salt Usage And Synthesis |
| Chemical Properties | white to light yellow powder and chunks | | Uses | Phospho(enol)pyruvic Acid Cyclohexylammonium Salt is a reagent in the general synthesis of ethers. | | Biochem/physiol Actions | Phospho(enol)pyruvic acid (PEP) is involved in glycolysis and gluconeogenesis. In glycolysis, PEP is metabolized by pyruvate kinase to yield pyruvate. In plants, PEP is involved in the formation of aromatic amino acids as well as in the carbon fixation pathway. |
| | Phosphoenolpyruvic acid cyclohexylammonium salt Preparation Products And Raw materials |
|