|
|
| | 4-FLUOROPHENYLHYDRAZINE Basic information |
| Product Name: | 4-FLUOROPHENYLHYDRAZINE | | Synonyms: | 1-(4-FLUOROPHENYL)HYDRAZINE;4-FLUOROPHENYLHYDRAZINE;AKOS BBS-00006439;4-Fluorophenylhydrazin;N-(4-Fluorophenyl)hydrazine;Hydrazine, (4-fluorophenyl)-;(4-Fluorophenyl)hydrazine - [F89850] | | CAS: | 371-14-2 | | MF: | C6H7FN2 | | MW: | 126.13 | | EINECS: | 206-732-9 | | Product Categories: | | | Mol File: | 371-14-2.mol |  |
| | 4-FLUOROPHENYLHYDRAZINE Chemical Properties |
| Melting point | 36.8 °C | | Boiling point | 227℃ | | density | 1.257 | | Fp | 91℃ | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | pka | 5.24±0.20(Predicted) | | Appearance | Yellow to brown Solid | | InChI | InChI=1S/C6H7FN2/c7-5-1-3-6(9-8)4-2-5/h1-4,9H,8H2 | | InChIKey | ZXBMIRYQUFQQNX-UHFFFAOYSA-N | | SMILES | N(C1=CC=C(F)C=C1)N |
| | 4-FLUOROPHENYLHYDRAZINE Usage And Synthesis |
| Uses | 4-Fluorophenylhydrazine is a versatile reactant used in various syntheses such as domino synthesis of indoles by zinc-promoted hydrohydrazination of terminal alkynes. |
| | 4-FLUOROPHENYLHYDRAZINE Preparation Products And Raw materials |
|