|
|
| | Diethylamine-d11 Basic information |
| | Diethylamine-d11 Chemical Properties |
| Melting point | -50 °C(lit.) | | Boiling point | 55 °C(lit.) | | density | 0.811 g/mL at 25 °C | | InChI | 1S/C4H11N/c1-3-5-4-2/h5H,3-4H2,1-2H3/i1D3,2D3,3D2,4D2/hD | | InChIKey | HPNMFZURTQLUMO-REUZILGJSA-N | | SMILES | [2H]N(C([2H])([2H])C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])[2H] |
| Hazard Codes | F,C | | Risk Statements | 11-20/21/22-35 | | Safety Statements | 3-16-26-29-36/37/39-45 | | WGK Germany | WGK 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Oral
Acute Tox. 4 Inhalation
Eye Dam. 1
Flam. Liq. 2
Skin Corr. 1A
STOT SE 3 |
| | Diethylamine-d11 Usage And Synthesis |
| Uses | Diethylamine-d11 (CAS# 1173019-51-6) is a useful isotopically labeled research compound. |
| | Diethylamine-d11 Preparation Products And Raw materials |
|