|
|
| | 3-(2-Naphthyl)-D-alanine Basic information |
| | 3-(2-Naphthyl)-D-alanine Chemical Properties |
| Boiling point | 355.53°C (rough estimate) | | density | 1.1242 (rough estimate) | | refractive index | 13 ° (C=1, 1mol/L HCl) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 2.21±0.30(Predicted) | | form | Solid | | color | Off-white | | Optical Rotation | Consistent with structure | | InChI | InChI=1/C13H13NO2/c14-12(13(15)16)8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7,12H,8,14H2,(H,15,16)/t12-/s3 | | InChIKey | JPZXHKDZASGCLU-PLAQIDKDNA-N | | SMILES | C(C1C=CC2C=CC=CC=2C=1)[C@@H](N)C(=O)O |&1:11,r| | | CAS DataBase Reference | 76985-09-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 29224999 |
| | 3-(2-Naphthyl)-D-alanine Usage And Synthesis |
| Chemical Properties | white fine powder | | Uses | H-D-2-Nal-OH is an alanine derivative[1]. | | Definition | ChEBI: 3-(2-Naphthyl)-D-Alanine is a member of naphthalenes. | | References | [1] Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-1035. DOI:10.1080/10408398.2012.708368 |
| | 3-(2-Naphthyl)-D-alanine Preparation Products And Raw materials |
|