|
|
| | 2,3-Dibromosuccinic acid Basic information |
| Product Name: | 2,3-Dibromosuccinic acid | | Synonyms: | 2,3-dibromo-butanedioicaci;2,3-Dibromobutanedioicacid;2,3-dibromo-Butanedioicacid;Butanedioicacid,2,3-dibromo-;sym-Dibromosucci-nicacid;2,3-Dibromosuccinic acid 98%;ALPHA,BETA-DIBROMOSUCCINIC ACID;2,3-DIBROMOSUCCINIC ACID | | CAS: | 526-78-3 | | MF: | C4H4Br2O4 | | MW: | 275.88 | | EINECS: | 208-396-9 | | Product Categories: | Carboxylic Acid Monomers;Carboxylic Acids;Chemical Synthesis;Materials Science;Organic Building Blocks;Polymer Science;Building Blocks;C1 to C5;Carbonyl Compounds;Organic acids;Acids and Esters;C1 to C5Polymer Science;Carbonyl Compounds;Carboxylic Acid Monomers;Carboxylic Acids;Monomers;Industrial/Fine Chemicals;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Organics | | Mol File: | 526-78-3.mol |  |
| | 2,3-Dibromosuccinic acid Chemical Properties |
| Melting point | 274 °C (subl.) | | Boiling point | 275℃(subl.) | | density | 2.2950 (rough estimate) | | refractive index | 1.4840 (estimate) | | storage temp. | Store below +30°C. | | pka | 1.80±0.28(Predicted) | | form | Solid | | color | White to off-white | | Water Solubility | 20g/L(17 ºC) | | Merck | 13,3054 | | InChI | InChI=1S/C4H4Br2O4/c5-1(3(7)8)2(6)4(9)10/h1-2H,(H,7,8)(H,9,10) | | InChIKey | FJWGRXKOBIVTFA-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(Br)C(Br)C(O)=O | | CAS DataBase Reference | 526-78-3(CAS DataBase Reference) | | EPA Substance Registry System | Butanedioic acid, 2,3-dibromo- (526-78-3) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29171990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2,3-Dibromosuccinic acid Usage And Synthesis |
| Uses | 2,3-Dibromosuccinic acid is an isomer of (±)-2,3-dibromosuccinic acid (HY-133681) and can be used as an experimental control. (±)-2,3-Dibromosuccinic acid is a key intermediate in the synthesis of dicarboxylic acid derivatives. |
| | 2,3-Dibromosuccinic acid Preparation Products And Raw materials |
|