|
|
| | 5-CHLORO-2,4-DINITROTOLUENE Basic information |
| Product Name: | 5-CHLORO-2,4-DINITROTOLUENE | | Synonyms: | 5-CHLORO-2,4-DINITROTOLUENE;1-CHLORO-5-METHYL-2,4-DINITROBENZENE;3-Chloro-4,6-dinitrotoluene;1-Chloro-2,4-dinitro-5-methylbenzene, 4,6-Dinitro-m-tolyl chloride;Benzene, 1-chloro-5-methyl-2,4-dinitro-;5-Chloro 2,4 dinitro toluene-97%;5-Chloro-2,4-dinitrotoluene;5-Chloro-2,4-dinitrotoluene 98% | | CAS: | 51676-74-5 | | MF: | C7H5ClN2O4 | | MW: | 216.58 | | EINECS: | | | Product Categories: | Nitro Compounds;Nitrogen Compounds;Organic Building Blocks | | Mol File: | 51676-74-5.mol |  |
| | 5-CHLORO-2,4-DINITROTOLUENE Chemical Properties |
| Melting point | 87-91 °C (lit.) | | Boiling point | 334.0±37.0 °C(Predicted) | | density | 1.4054 g/cm3(Temp: 99.2 °C) | | form | solid | | BRN | 2506591 | | InChI | 1S/C7H5ClN2O4/c1-4-2-5(8)7(10(13)14)3-6(4)9(11)12/h2-3H,1H3 | | InChIKey | KPDPGZNHKMJEFZ-UHFFFAOYSA-N | | SMILES | Cc1cc(Cl)c(cc1[N+]([O-])=O)[N+]([O-])=O | | CAS DataBase Reference | 51676-74-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 36/37 | | RIDADR | 2811 | | WGK Germany | 3 | | Hazard Note | Harmful/Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29049090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | 5-CHLORO-2,4-DINITROTOLUENE Usage And Synthesis |
| Uses | 5-Chloro-2,4-dinitrotoluene (5CDNT) may be used to synthesize 5-methyl-6-nitrobenzofuroxan. | | General Description | A molecular imprinted polymer (MIP) based electrochemical impedimetric sensor has been fabricated for the sensitive determination of 5CDNT. Low-detection-limit of 5CDNT was observed to be 0.1μM using this sensor. |
| | 5-CHLORO-2,4-DINITROTOLUENE Preparation Products And Raw materials |
|