BOC-GLY-GLY-PHE-GLY-OH manufacturers
|
| | BOC-GLY-GLY-PHE-GLY-OH Basic information |
| Product Name: | BOC-GLY-GLY-PHE-GLY-OH | | Synonyms: | BOC-GLY-GLY-PHE-GLY-OH;2-[[(2S)-2-[[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetic acid;Glycine, N-[(1,1-dimethylethoxy)carbonyl]glycylglycyl-L-phenylalanyl-;N-[(1,1-Dimethylethoxy)carbonyl]glycylglycyl-L-phenylalanylglycine;(S)-12-benzyl-2,2-dimethyl-4,7,10,13-tetraoxo-3-oxa-5,8,11,14-tetraazahexadecan-16-oic acid;Boc-glycyl-glycyl-L-phenylalanylglycine;N-Boc-glycyl-glycyl-L-phenylalanyl-glycine;2-[[(2S)-2-[[2-[[2-(tert-butoxycarbonylamino)acetyl]amino]acetyl]amino]-3-phenyl-propanoyl]amino]acetic acid | | CAS: | 187794-49-6 | | MF: | C20H28N4O7 | | MW: | 436.46 | | EINECS: | | | Product Categories: | ADCs Linkers | | Mol File: | Mol File |  |
| | BOC-GLY-GLY-PHE-GLY-OH Chemical Properties |
| Boiling point | 838.6±65.0 °C(Predicted) | | density | 1.263±0.06 g/cm3(Predicted) | | storage temp. | -15°C | | solubility | DMSO : ≥ 100 mg/mL (229.12 mM)| | | pka | 3.32±0.10(Predicted) | | form | Solid | | color | White to off-white | | Water Solubility | Water : 25 mg/mL (57.28 mM; Need ultrasonic) | | Sequence | Boc-Gly-Gly-Phe-Gly-OH | | InChIKey | PTUJJIPXBJJLLV-AWEZNQCLSA-N | | SMILES | C(O)(=O)CNC(=O)[C@H](CC1=CC=CC=C1)NC(=O)CNC(=O)CNC(OC(C)(C)C)=O |
| | BOC-GLY-GLY-PHE-GLY-OH Usage And Synthesis |
| Description | Boc-Gly-Gly-Phe-Gly-OH is a self-assembly of N- and C-protected tetrapeptide, is a protease cleavable linker used for the antibody-drug conjugate (ADC). | | Uses | Boc-Gly-Gly-Phe-Gly-OH, a self-assembly of N- and C-protected tetrapeptide, is a protease cleavable linker used for the antibody-drug conjugate (ADC). | | IC 50 | Cleavable Linker | | References | [1] Dernovics M, et al., Synthesis and application of a Sec2-containing oligopeptide for method evaluation purposes in selenium speciation. Talanta. 2012 Sep 15;99:186-93. DOI:10.1016/j.talanta.2012.05.038 |
| | BOC-GLY-GLY-PHE-GLY-OH Preparation Products And Raw materials |
|