|
|
| | S-(Trifluoromethyl)dibenzothiophenium tetrafluoroborate Basic information |
| | S-(Trifluoromethyl)dibenzothiophenium tetrafluoroborate Chemical Properties |
| Melting point | 171-172°C | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C13H8F3S.BF4/c14-13(15,16)17-11-7-3-1-5-9(11)10-6-2-4-8-12(10)17;2-1(3,4)5/h1-8H;/q+1;-1 | | InChIKey | VTVISWLINKWMQZ-UHFFFAOYSA-N | | SMILES | [B+3]([F-])([F-])([F-])[F-].C([S+]1C2=CC=CC=C2C2C=CC=CC1=2)(F)(F)F | | CAS DataBase Reference | 131880-16-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29349990 |
| | S-(Trifluoromethyl)dibenzothiophenium tetrafluoroborate Usage And Synthesis |
| Chemical Properties | White to yellow solid | | Uses | 5-(Trifluoromethyl)dibenzothiophenium Tetrafluoroborate is used to synthesize ortho-trifluoromethylated and ortho-(fluoro)alkylated pyridine derivatives. It is used as a CF3 source under visible light irradiation for the photoredox-catalyzed trifluoromethylation of electron rich alkene resulting in 1,3-bis(trifluoromethyl)-1-propenyl skeleton. |
| | S-(Trifluoromethyl)dibenzothiophenium tetrafluoroborate Preparation Products And Raw materials |
|