|
|
| | 3-METHYLCYCLOHEXYLAMINE Basic information |
| Product Name: | 3-METHYLCYCLOHEXYLAMINE | | Synonyms: | 3-Methylcyclohexylamine (cis- and trans- mixture);1-Amino-3-methylcyclohexane;3-Methylcyclohexan-1-aMine;1,3-AMinoMethylcyclohexane;3-METHYLCYCLOHEXYLAMINE;3-methylcyclohexylamine, mixed isomers;3-Methylcyclohexanamine;Cyclohexanamine, 3-methyl- | | CAS: | 6850-35-7 | | MF: | C7H15N | | MW: | 113.2 | | EINECS: | 229-940-1 | | Product Categories: | CMLLYL | | Mol File: | 6850-35-7.mol |  |
| | 3-METHYLCYCLOHEXYLAMINE Chemical Properties |
| Melting point | -8.5°C (estimate) | | Boiling point | 151°C(lit.) | | density | 0.8550 | | refractive index | 1.4510 to 1.4550 | | Fp | 22 °C | | storage temp. | 2-8°C, protect from light | | solubility | Chloroform (Sparingly), Methanol (Sparingly) | | form | clear liquid | | pka | 10.61±0.70(Predicted) | | color | Colorless to Almost colorless | | Henry's Law Constant | 1.1×100 mol/(m3Pa) at 25℃, Hilal et al. (2008) | | InChI | InChI=1S/C7H15N/c1-6-3-2-4-7(8)5-6/h6-7H,2-5,8H2,1H3 | | InChIKey | JYDYHSHPBDZRPU-UHFFFAOYSA-N | | SMILES | C1(N)CCCC(C)C1 |
| Hazard Codes | F,C | | Risk Statements | 10-22-34 | | RIDADR | UN 2733 3/8/PG II | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | PackingGroup | II | | HS Code | 2921309990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Flam. Liq. 2
Skin Corr. 1B |
| | 3-METHYLCYCLOHEXYLAMINE Usage And Synthesis |
| | 3-METHYLCYCLOHEXYLAMINE Preparation Products And Raw materials |
|