| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:Methyl 1-chloro-4-hydroxyisoquinoline-3-carboxylate
CAS:223388-20-3
Purity:97% Package:1G
|
| Company Name: |
Nantong Bosu Pharmaceutical Technology Co., Ltd.
|
| Tel: |
15962844273 |
| Email: |
tashiyxy@163.com |
| Products Intro: |
Product Name:Methyl 1-chloro-4-hydroxyisoquinoline-3-carboxylate
CAS:223388-20-3
Purity:>95% Package:1G;5G;10G;25G;50G;100G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Methyl 1-chloro-4-hydroxyisoquinoline-3-carboxylate
CAS:223388-20-3
Purity:95% Package:1G Remarks:697001-1G
|
| Company Name: |
Changzhou Hopschain Chemical Co.,Ltd.
|
| Tel: |
0519-85528066 13775048983 |
| Email: |
sales@hopschem.com |
| Products Intro: |
Product Name:methyl 1-chloro-4-hydroxyisoquinoline-3-carboxylate
CAS:223388-20-3
Purity:95+% Package:100mg;250mg;500mg;1g;2.5g;5g;10g
|
| Company Name: |
Shanghai Rechem science Co., Ltd.
|
| Tel: |
021-31433387 15618786686 |
| Email: |
sales@rechemscience.com |
| Products Intro: |
Product Name:Methyl 1-chloro-4-hydroxyisoquinoline-3-carboxylate
CAS:223388-20-3
Purity:97% HPLC Package:1g;5g;10g
|
|
| | Methyl 1-chloro-4-hydroxyisoquinoline-3-carboxylate Basic information |
| | Methyl 1-chloro-4-hydroxyisoquinoline-3-carboxylate Chemical Properties |
| Melting point | 164-168 °C | | form | powder | | InChI | 1S/C11H8ClNO3/c1-16-11(15)8-9(14)6-4-2-3-5-7(6)10(12)13-8/h2-5,14H,1H3 | | InChIKey | JCLXQWPJRSUMFT-UHFFFAOYSA-N | | SMILES | COC(=O)c1nc(Cl)c2ccccc2c1O |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | Methyl 1-chloro-4-hydroxyisoquinoline-3-carboxylate Usage And Synthesis |
| | Methyl 1-chloro-4-hydroxyisoquinoline-3-carboxylate Preparation Products And Raw materials |
|