| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (2R)-1-Boc-4-oxopipecolic acid Basic information |
| Product Name: | (2R)-1-Boc-4-oxopipecolic acid | | Synonyms: | (2R)-1-Boc-4-oxopipecolic acid;(R)-1-Boc-4-oxopiperidine-2-carboxylic acid;(2R)-4-Oxo-1,2-piperidinedicarboxylic acid 1-(1,1-dimethylethyl) ester;(R)-1-Boc-4-oxopiperidine-2-carboxylic acid 96%;(R)-1-N-Boc-4-oxo-piperidine-2-carboxylic acid;(R)-1-Boc-4-oxopiperidine-2-carboxylic acid 9;(2R)-4-Oxopiperidine-2-carboxylic acid, N-BOC protected 97%;1,2-Piperidinedicarboxylic acid, 4-oxo-, 1-(1,1-dimethylethyl) ester, (2R)- | | CAS: | 1212176-33-4 | | MF: | C11H17NO5 | | MW: | 243.26 | | EINECS: | | | Product Categories: | | | Mol File: | 1212176-33-4.mol |  |
| | (2R)-1-Boc-4-oxopipecolic acid Chemical Properties |
| Melting point | 119-124 °C | | Boiling point | 403.6±45.0 °C(Predicted) | | density | 1.257 | | storage temp. | Inert atmosphere,Room Temperature | | form | solid | | pka | 3.95±0.20(Predicted) | | color | Pale yellow | | Optical Rotation | [α]22/D +22.0°, c = 1 in chloroform | | Sensitive | Air & Moisture Sensitive | | InChI | InChI=1S/C11H17NO5/c1-11(2,3)17-10(16)12-5-4-7(13)6-8(12)9(14)15/h8H,4-6H2,1-3H3,(H,14,15)/t8-/m1/s1 | | InChIKey | GPBCBXYUAJQMQM-MRVPVSSYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(=O)C[C@@H]1C(O)=O |
| WGK Germany | 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids |
| | (2R)-1-Boc-4-oxopipecolic acid Usage And Synthesis |
| Uses | (R)-1-Boc-4-oxopiperidine-2-carboxylic Acid is a reagent used in the synthesis of EP4 modulators as well as CDK9 kinase inhibitors in the treatment of various diseases including cancer. |
| | (2R)-1-Boc-4-oxopipecolic acid Preparation Products And Raw materials |
|