2,4,6-trimethyl-1,3,5-triazine manufacturers
|
| | 2,4,6-trimethyl-1,3,5-triazine Basic information | | Application |
| Product Name: | 2,4,6-trimethyl-1,3,5-triazine | | Synonyms: | 2,4,6-trimethyl-1,3,5-triazine;1,3,5-Triazine, 2,4,6-trimethyl-;Finerenone Impurity 80 | | CAS: | 823-94-9 | | MF: | C6H9N3 | | MW: | 123.16 | | EINECS: | 200-258-5 | | Product Categories: | | | Mol File: | 823-94-9.mol |  |
| | 2,4,6-trimethyl-1,3,5-triazine Chemical Properties |
| Melting point | 59-60 °C | | Boiling point | 154-156 °C(Press: 750 Torr) | | density | 1.044±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.41±0.10(Predicted) | | Appearance | Off-white to light yellow <59°C Solid,>60°C Liquid | | InChI | InChI=1S/C6H9N3/c1-4-7-5(2)9-6(3)8-4/h1-3H3 | | InChIKey | LASVAZQZFYZNPK-UHFFFAOYSA-N | | SMILES | N1=C(C)N=C(C)N=C1C |
| | 2,4,6-trimethyl-1,3,5-triazine Usage And Synthesis |
| Application | 2,4,6-Trimethyl-1,3,5-triazine can be used as a chemical and pharmaceutical intermediate in laboratory research and development and chemical and pharmaceutical synthesis processes. | | Synthesis Reference(s) | Journal of Heterocyclic Chemistry, 25, p. 789, 1988 DOI: 10.1002/jhet.5570250315 |
| | 2,4,6-trimethyl-1,3,5-triazine Preparation Products And Raw materials |
|