- Vanillylmandelic acid
-
- $80.00 / 100mg
-
2026-03-13
- CAS:55-10-7
- Min. Order:
- Purity: 99.83%
- Supply Ability: 10g
- Vanillylmandelic acid
-
- $80.00 / 100mg
-
2026-03-13
- CAS:55-10-7
- Min. Order:
- Purity: 99.83%
- Supply Ability: 10g
|
| | 4-Hydroxy-3-methoxymandelic acid Basic information |
| | 4-Hydroxy-3-methoxymandelic acid Chemical Properties |
| Melting point | 132-134 °C (dec.)(lit.) | | Boiling point | 255.48°C (rough estimate) | | density | 1.2539 (rough estimate) | | FEMA | 4660 | HYDROXY(4-HYDROXY-3-METHOXYPHENYL)ACETIC ACID | | refractive index | 1.4570 (estimate) | | storage temp. | 2-8°C | | solubility | H2O: ~50 mg/mL | | pka | 3.42±0.10(Predicted) | | form | powder | | color | white to off-white | | Water Solubility | freely soluble | | JECFA Number | 2020 | | Merck | 14,9933 | | BRN | 2213227 | | Major Application | clinical testing | | InChI | 1S/C9H10O5/c1-14-7-4-5(2-3-6(7)10)8(11)9(12)13/h2-4,8,10-11H,1H3,(H,12,13) | | InChIKey | CGQCWMIAEPEHNQ-UHFFFAOYSA-N | | SMILES | OC1=C(OC)C=C(C(O)C(O)=O)C=C1 | | LogP | -0.212 (est) | | EPA Substance Registry System | Benzeneacetic acid, .alpha.,4-dihydroxy-3-methoxy- (55-10-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | F | 10-23 | | TSCA | TSCA listed | | HS Code | 29181998 | | Storage Class | 11 - Combustible Solids |
| | 4-Hydroxy-3-methoxymandelic acid Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | A metabolite of catecholamines. | | Definition | ChEBI: An aromatic ether that is the 3-O-methyl ether of 3,4-dihydroxymandelic acid. | | Biochem/physiol Actions | Epinephrine and norepineprine metabolite. | | in vivo | Vanillylmandelic acid (intra-arterial injection over 1 min; 1, 10 and 100 mg/kg; the 60 min-observation period) produces a significant difference between vanillylmandelic acid groups and controls. Vanillylmandelic acid decreases the heart rate by 17.5%, 17.9% and 18.9% after 1, 10 and 100 mg/kg, respectively. Mean blood pressure is decreased by 13.5% in control animals as compared to 37%, 23% and 26% after 1, 10 and 100 mg/kg, respectively, in wistar rats[1]. | | IC 50 | Human Endogenous Metabolite; Microbial Metabolite |
| | 4-Hydroxy-3-methoxymandelic acid Preparation Products And Raw materials |
|