- Polyquaternium-22
-
- $8.70 / 1KG
-
2025-05-26
- CAS:53694-17-0
- Min. Order: 10KG
- Purity: 40%
- Supply Ability: 10000kg
- Polyquaternium-22
-
- $8.00 / 1KG
-
2025-04-16
- CAS:53694-17-0
- Min. Order: 1KG
- Purity: 99%HPLC,USP Standard
- Supply Ability: 5Tons
|
| | Polyquaternium-22 Basic information | | Uses |
| Product Name: | Polyquaternium-22 | | Synonyms: | Dimethyldiallylammonium chloride acrylic acid polymer;n,n-dimethyl-n-2-propenyl-2-propen-1-aminium chloride polymer with 2-propenoic acid;Polyquaternium-22;Polyquaternium-22 Cas NO.: 53694-17-0;Polyquaternium-22 (HD-M22) | | CAS: | 53694-17-0 | | MF: | C11H20ClNO2 | | MW: | 233.74 | | EINECS: | 203-326-3 | | Product Categories: | | | Mol File: | 53694-17-0.mol |  |
| | Polyquaternium-22 Chemical Properties |
| Cosmetics Ingredients Functions | ANTISTATIC
FILM FORMING | | InChI | InChI=1S/C8H16N.C3H4O2.ClH/c1-5-7-9(3,4)8-6-2;1-2-3(4)5;/h5-6H,1-2,7-8H2,3-4H3;2H,1H2,(H,4,5);1H/q+1;;/p-1 | | InChIKey | SHPKFHOYQTVLAR-UHFFFAOYSA-M | | SMILES | C(=O)(O)C=C.[N+](C)(C)(CC=C)CC=C.[Cl-] |
| | Polyquaternium-22 Usage And Synthesis |
| Uses | Polyquaternium-22 is an amphoteric polymer with strong moisturizing properties. It has good moisturizing effects and is suitable for use in moisturizing creams, shaving creams, hand soaps, shower gels, and shampoos. |
| | Polyquaternium-22 Preparation Products And Raw materials |
|