|
|
| | (R)-(-)-4-Phenyl-2-oxazolidinone Basic information |
| | (R)-(-)-4-Phenyl-2-oxazolidinone Chemical Properties |
| Melting point | 131-133 °C(lit.) | | alpha | -49.5 º (c=2, CHCl3) | | Boiling point | 290.25°C (rough estimate) | | density | 1.2021 (rough estimate) | | refractive index | -72 ° (C=1, AcOEt) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate, Methanol (Slightly) | | form | Solid | | pka | 12.05±0.40(Predicted) | | color | White to Off-White | | Optical Rotation | [α]25/D 48°, c = 2 in chloroform | | BRN | 4308995 | | InChI | InChI=1S/C9H9NO2/c11-9-10-8(6-12-9)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,10,11)/t8-/m0/s1 | | InChIKey | QDMNNMIOWVJVLY-QMMMGPOBSA-N | | SMILES | O1C[C@@H](C2=CC=CC=C2)NC1=O | | CAS DataBase Reference | 90319-52-1(CAS DataBase Reference) |
| | (R)-(-)-4-Phenyl-2-oxazolidinone Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | synthon for a-amino acids and b-lactam antibiotics | | Uses | (R)-(-)-4-Phenyl-2-oxazolidinone (cas# 90319-52-1) is a compound useful in organic synthesis. | | Uses | Used for α-amino acid synthesis and the preparation of β-lactam antibiotics. |
| | (R)-(-)-4-Phenyl-2-oxazolidinone Preparation Products And Raw materials |
|