| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3,3'-Ethylenedioxydiphenol Basic information |
| Product Name: | 3,3'-Ethylenedioxydiphenol | | Synonyms: | 3,3’-[1,2-ethanediylbis(oxy)]bis-pheno;3,3'-(Ethylenebisoxy)bisphenol;3,3'-(Ethylenedioxy)bisphenol;Bisresorcine ethylene ether;Einecs 262-630-4;Phenol, 3,3'-(1,2-ethanediylbis(oxy))bis-;1,2-Bis(3-hydroxyphenoxy)ethane
Ethylene Glycol Bis(3-hydroxyphenyl) Ether;3,3'-(Ethylenedioxy)diphenol 85%, technical grade | | CAS: | 61166-00-5 | | MF: | C14H14O4 | | MW: | 246.26 | | EINECS: | 262-630-4 | | Product Categories: | Fluorenes, etc. (reagent for high-performance polymer research);Functional Materials;Reagent for High-Performance Polymer Research;Alcohols;Monomers;Polymer Science | | Mol File: | 61166-00-5.mol |  |
| | 3,3'-Ethylenedioxydiphenol Chemical Properties |
| Melting point | 157-160 °C(lit.) | | density | 1.261 | | form | solid | | InChI | 1S/C14H14O4/c15-11-3-1-5-13(9-11)17-7-8-18-14-6-2-4-12(16)10-14/h1-6,9-10,15-16H,7-8H2 | | InChIKey | DBFHCPVZZSVFJL-UHFFFAOYSA-N | | SMILES | Oc1cccc(OCCOc2cccc(O)c2)c1 | | EPA Substance Registry System | Phenol, 3,3'-[1,2-ethanediylbis(oxy)]bis- (61166-00-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3,3'-Ethylenedioxydiphenol Usage And Synthesis |
| | 3,3'-Ethylenedioxydiphenol Preparation Products And Raw materials |
|