|
|
| | 2,6-NAPHTHALENEDICARBOXYLIC ACID Basic information |
| Product Name: | 2,6-NAPHTHALENEDICARBOXYLIC ACID | | Synonyms: | TIMTEC-BB SBB008377;2,6-NAPHTHALENEDICARBOXYLIC ACID;2,6-NAPHTHALIC ACID;2,6-NAPHTHALENEDICARBOXYLIC ACID, 99.5+%;2,6-NAPHTHALENEDICARBOXYLIC ACID 98+%;Naphthalene-2,6-dicarboxylic acid, 98+%;Naphthalene-2,6-dicarboxylic acid 99%;2,6-NAPTHALENEDICARBOXYLIC ACID | | CAS: | 1141-38-4 | | MF: | C12H8O4 | | MW: | 216.19 | | EINECS: | 214-527-0 | | Product Categories: | Achiral Oxygen;Naphthalene derivatives;Aromatics;Intermediates & Fine Chemicals;Pharmaceuticals;Carboxylic Acid MonomersAlternative Energy;Physisorption;Materials for Hydrogen Storage;Monomers;Polymer Science;C11 to C12;Carbonyl Compounds;Carboxylic Acids;Intermediates of Dyes and Pigments | | Mol File: | 1141-38-4.mol |  |
| | 2,6-NAPHTHALENEDICARBOXYLIC ACID Chemical Properties |
| Melting point | >300 °C (lit.) | | Boiling point | 316.6°C (rough estimate) | | density | 1.5 | | refractive index | 1.7080 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | very faint turbidity in hot Pyridine | | pka | 3.69±0.30(Predicted) | | form | Powder | | color | white | | Water Solubility | 3μg/L at 20℃ | | BRN | 2051257 | | InChI | InChI=1S/C12H8O4/c13-11(14)9-3-1-7-5-10(12(15)16)4-2-8(7)6-9/h1-6H,(H,13,14)(H,15,16) | | InChIKey | RXOHFPCZGPKIRD-UHFFFAOYSA-N | | SMILES | C1=C2C(C=C(C(O)=O)C=C2)=CC=C1C(O)=O | | LogP | 2.22 | | CAS DataBase Reference | 1141-38-4(CAS DataBase Reference) | | EPA Substance Registry System | 2,6-Naphthalenedicarboxylic acid (1141-38-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29173990 | | Storage Class | 11 - Combustible Solids |
| | 2,6-NAPHTHALENEDICARBOXYLIC ACID Usage And Synthesis |
| Chemical Properties | BEIGE POWDER | | Uses | A polybasic acid intended for use as components of resinous and polymeric coatings that contact food. | | Uses | 2,6-naphthalenedicarboxylic acid is an important product for the manufacture of high strength and excellent dyeing properties of polyester fibers and F class insulation material, is an important monomer performance PEN, PBN, liquid crystal polymer (LCP) and polyurethane resin pharmaceutical and fine chemicals raw material. | | Uses | 2,6-Naphthalenedicarboxylic acid (H2ndc) can be used in the formation of metal-organic coordination polymers (MOCPs) for potential applications in various fields such as adsorption, separation, and magnetism. It can also be used as a monomer in the production of polyesters. H2ndc can also be used in the synthesis of a metal-organic framework (MOF), which can further be used as a drug carrier. | | Definition | ChEBI: Naphthalene-2,6-dicarboxylic acid is a dicarboxylic acid. It derives from a hydride of a naphthalene. | | General Description | This product has been enhanced for energy efficiency. | | Flammability and Explosibility | Not classified | | Synthesis | 2,6-Naphthalenedicarboxylic acid (2,6-NDA) is selectively synthesized from 2-naphthoic acid (2-NCA) and carbon tetrachloride in aqueous sodium hydroxide solution under mild conditions using cyclodextrin (β-CyD) as a catalyst[1]. The specific reaction steps are as follows:
Three mmol of 2-naphthalenecarboxylic acid/2-NCA), 0,8 mmol(0,05 g) of copper powder, and 3,0 mmol of β-CyD were added to 30 mL of 30 wt.-% aqueous sodium hydroxide solution. The reaction was started with the addition of 8,5 mmol of carbon tetrachloride and was continued at 60°C for 7 h with magnetic stirring under nitrogen. Then, the residual carbon tetrachloride was removed by evaporation under reduced pressure.
| | References | [1] HIDEFUMI HIRAI; Rikinori T; Hisashi Mihori. Selective synthesis of 2,6-naphthalenedicarboxylic acid using cyclodextrin as catalyst[J]. Macromolecular Rapid Communications, 1993, 14 7: 439-443. DOI:10.1002/marc.1993.030140712. |
| | 2,6-NAPHTHALENEDICARBOXYLIC ACID Preparation Products And Raw materials |
|