| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Bis(3,5-di(trifluoromethyl)phenyl)chlorophosphine Basic information |
| Product Name: | Bis(3,5-di(trifluoromethyl)phenyl)chlorophosphine | | Synonyms: | BIS[BIS(3,5-TRIFLUOROMETHYL)PHENYL]CHLOROPHOSPHINE;Chlorobis[3,5-bis(trifluoromethyl)phenyl]phosphine, 98+%;Chlorobis[3,5-bis(trifluoromethyl)phenyl]phosphine;Chlorobis[3,5-bis(trifluoromethyl)phenyl]phosphine, 98+%, may contain suspended dimethylamine hydrochloride crystals;P,P-Bis[3,5-bis(trifluoromethyl)phenyl]phosphinous chloride;bis[3,5-bis(trifluoromethyl)phenyl]-chlorophosphane;Bis(3,5-di(trifluoroMethyl)phenyl)chlorophosphine,Min.98%;Phosphinous chloride, P,P-bis[3,5-bis(trifluoromethyl)phenyl]- | | CAS: | 142421-57-6 | | MF: | C16H6ClF12P | | MW: | 492.63 | | EINECS: | | | Product Categories: | Catalysis and Inorganic Chemistry;Phosphorus Compounds;Phosphorus Precursors;organophosphine ligand;Achiral Phosphine;Aryl Phosphine;P-Cl | | Mol File: | 142421-57-6.mol |  |
| | Bis(3,5-di(trifluoromethyl)phenyl)chlorophosphine Chemical Properties |
| Melting point | 25-29 °C | | Boiling point | 333.2±42.0 °C(Predicted) | | form | liquid | | color | colorless | | Water Solubility | Reacts with water. | | Sensitive | Moisture Sensitive | | InChI | 1S/C16H6ClF12P/c17-30(11-3-7(13(18,19)20)1-8(4-11)14(21,22)23)12-5-9(15(24,25)26)2-10(6-12)16(27,28)29/h1-6H | | InChIKey | DFZQEHBNAJGDCT-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1cc(cc(c1)C(F)(F)F)P(Cl)c2cc(cc(c2)C(F)(F)F)C(F)(F)F |
| Hazard Codes | C | | Risk Statements | 14-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN3265 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | II | | Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water | | Hazard Classifications | Skin Corr. 1B Water-react 3 |
| | Bis(3,5-di(trifluoromethyl)phenyl)chlorophosphine Usage And Synthesis |
| Uses | Chlorobis[3,5-bis(trifluoromethyl)phenyl]phosphine is used as a reactant for the synthesis of chiral phosphine-aminophosphine ligands for rhodium-catalyzed asymmetric hydrogenation, ligands for palladium-catalyzed stereoselective allylation reactions, enantioselective hydrogenations, Josiphos analog as catalyst for asymmetric hydrogenation, ligands used in asymmetric hydrovinylation reactions. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: ligand |
| | Bis(3,5-di(trifluoromethyl)phenyl)chlorophosphine Preparation Products And Raw materials |
|