Propane-1,3-di(sulfonyl chloride) manufacturers
|
| | Propane-1,3-di(sulfonyl chloride) Basic information |
| Product Name: | Propane-1,3-di(sulfonyl chloride) | | Synonyms: | Propane-1,3-di(sulfonyl chloride);Propane-1,3-disulfonyl dichloride;1,3-Propanedisulfonyl dichloride;1,3-Propane Disulfonyl chloride;1-3 propane-1,3-disulfonyl chloride;1,3-propanediyl disulfide chloride | | CAS: | 20686-91-3 | | MF: | C3H6Cl2O4S2 | | MW: | 241.11 | | EINECS: | | | Product Categories: | | | Mol File: | 20686-91-3.mol |  |
| | Propane-1,3-di(sulfonyl chloride) Chemical Properties |
| Melting point | 48 °C | | Boiling point | 325.5±25.0 °C(Predicted) | | density | 1.687±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C3H6Cl2O4S2/c4-10(6,7)2-1-3-11(5,8)9/h1-3H2 | | InChIKey | QHABYFQJNLKLOR-UHFFFAOYSA-N | | SMILES | C(S(Cl)(=O)=O)CCS(Cl)(=O)=O |
| | Propane-1,3-di(sulfonyl chloride) Usage And Synthesis |
| | Propane-1,3-di(sulfonyl chloride) Preparation Products And Raw materials |
|