Tert-Butyl 4-Vinylphenyl Carbonate manufacturers
- TERT-BUTYL 4-VINYLPHENYL CARBONATE
-
- $50.00 / 100kg
-
2026-04-17
- CAS:87188-51-0
- Min. Order: 1kg
- Purity: 99%，Electronic grade(Single metal impurity≤ 100ppb)
- Supply Ability: 100kg
|
| | Tert-Butyl 4-Vinylphenyl Carbonate Basic information |
| Product Name: | Tert-Butyl 4-Vinylphenyl Carbonate | | Synonyms: | 1,1-dimethylethyl4-ethenylphenylcarbonate;4-boc-styrene;c-1566;carbonicacid,1,1-dimethylethyl4-ethenylphenylester;p-tert-butoxycarbonyloxystyrenemonomer;4-(tert-Butoxycarbonyloxy)styrene;4-(TERT-BUTOXYCARBONYLOXY)STYRENE;TERT-BUTYL P-VINYLPHENYL CARBONATE;tert-Butyl p-vinylphenyl carbonate | | CAS: | 87188-51-0 | | MF: | C13H16O3 | | MW: | 220.26 | | EINECS: | | | Product Categories: | | | Mol File: | 87188-51-0.mol |  |
| | Tert-Butyl 4-Vinylphenyl Carbonate Chemical Properties |
| Melting point | 27-29 °C(lit.) | | Boiling point | 187 °C(lit.) | | density | 1.1101 (rough estimate) | | refractive index | 1.5090 (estimate) | | Fp | >230 °F | | storage temp. | -20°C, sealed storage, away from moisture | | Appearance | Colorless to light yellow Viscous Liquid | | InChI | InChI=1S/C13H16O3/c1-5-10-6-8-11(9-7-10)15-12(14)16-13(2,3)4/h5-9H,1H2,2-4H3 | | InChIKey | GJWMYLFHBXEWNZ-UHFFFAOYSA-N | | SMILES | C(OC1=CC=C(C=C)C=C1)(=O)OC(C)(C)C | | EPA Substance Registry System | Carbonic acid, 1,1-dimethylethyl 4-ethenylphenyl ester (87188-51-0) |
| WGK Germany | 2 | | RTECS | FG0460000 |
| | Tert-Butyl 4-Vinylphenyl Carbonate Usage And Synthesis |
| Uses | Used as an intermediate in organic synthesis. | | Application |
Tert-Butyl 4-Vinylphenyl Carbonate (tBVPC) could be used to synthesize a terpolymer, which is a novel chemically amplified positive photoresist with methyl methacrylate (MMA)triphenylsulfonium salt methacrylate (TPSMA). In addition, Lithographic performance of a PAG-bound polymer resist based on tert-butyl 4-vinyl phenyl carbonate, n-[p-(t-butyloxycarbonyloxy) phenyl]maleimide terpolymers as a novel chemically amplified resist exhibited a positive working behavior. They showed 0.18 μm line pattern at electron beam lithography to indicate that the polymer bounded PAG resists have a potential to fabricate nanostructures[1].
| | Hazard | Moderately toxic by skin contact. A mild
skin irritant. | | Synthesis | Tert-Butyl 4-Vinylphenyl Carbonate was prepared by reacting 4-Hydroxystyrene with Di-tert-butyl dicarbonate in prestence of Tetramethylammonium hydroxide in water. | | References | [1] Jae Beom Yoo . “Triphenylsulfonium salt methacrylate bound polymer resist for electron beam lithography.” Polymer 55 16 (2014): Pages 3599-3604.
|
| | Tert-Butyl 4-Vinylphenyl Carbonate Preparation Products And Raw materials |
|