| Company Name: |
Energy Chemical Gold
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:2-Chloro-2-methylpropane-d9 CAS:918-20-7 Package:100mg/RMB 60;250mg/RMB 129
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:2-Chloro-2-Methylpropane-d9 CAS:918-20-7 Package:100Mg,1g
|
|
| | 2-CHLORO-2-METHYLPROPANE-D9 Basic information |
| Product Name: | 2-CHLORO-2-METHYLPROPANE-D9 | | Synonyms: | TERT-BUTYL-D9 CHLORIDE;TERT-BUTYL CHLORIDE (D9);2-CHLORO-2-METHYLPROPANE-D9;[2H9]-tert-butylchloride;2-CHLORO-2-METHYLPROPANE-D9, 99 ATOM % D;Propane-1,1,1,3,3,3-d6, 2-chloro-2-(methyl-d3)-;(2-Cloro-2-Methylpropane);2-Chloro-2-(2H3)methyl(1,1,1,3,3,3-2H6)propane | | CAS: | 918-20-7 | | MF: | C4ClD9 | | MW: | 101.62 | | EINECS: | 213-041-6 | | Product Categories: | Isotope Labelled Compounds, Pharmaceuticals, Intermediates & Fine Chemicals | | Mol File: | 918-20-7.mol |  |
| | 2-CHLORO-2-METHYLPROPANE-D9 Chemical Properties |
| Melting point | -25 °C(lit.) | | Boiling point | 51-52 °C(lit.) | | density | 0.933 g/mL at 25 °C | | vapor pressure | 5.11 psi ( 20 °C) | | refractive index | n20/D 1.3819(lit.) | | Fp | 65 °F | | storage temp. | Refrigerator | | solubility | Chlroform (Soluble), Methanol (Slightly) | | form | Oil | | color | Colourless | | Stability: | Volatile | | InChI | InChI=1S/C4H9Cl/c1-4(2,3)5/h1-3H3/i1D3,2D3,3D3 | | InChIKey | NBRKLOOSMBRFMH-GQALSZNTSA-N | | SMILES | C(Cl)(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] | | CAS Number Unlabeled | 507-20-0 |
| Hazard Codes | F | | Risk Statements | 11 | | Safety Statements | 16-29-33-7/9 | | RIDADR | UN 1127 3/PG 2 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2 |
| | 2-CHLORO-2-METHYLPROPANE-D9 Usage And Synthesis |
| Uses | Isotope labelled 2-Chloro-2-methylpropane is a starting molecule to carry out nucleophilic substitution reactions. |
| | 2-CHLORO-2-METHYLPROPANE-D9 Preparation Products And Raw materials |
|