|
|
| | 3,3',5,5'-TETRAMETHYLBIPHENYL Basic information |
| Product Name: | 3,3',5,5'-TETRAMETHYLBIPHENYL | | Synonyms: | 1,1'-Biphenyl, 3,3',5,5'-tetramethyl-;Biphenyl, 3,3',5,5'-tetramethyl-;3,3'',5,5''-TETRAMETHYLBIPHENYL, 97+%;3,3',5,5'-Tetramethylbiphenyl;3,3',5,5'-tetramethyl-1,1'-biphenyl;3,3',5,5'-Tetramethylbiphenyl | | CAS: | 25570-02-9 | | MF: | C16H18 | | MW: | 210.31 | | EINECS: | | | Product Categories: | | | Mol File: | 25570-02-9.mol |  |
| | 3,3',5,5'-TETRAMETHYLBIPHENYL Chemical Properties |
| Melting point | 47-49°C | | Boiling point | 110 °C(Press: 0.4 Torr) | | density | 0.956±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | form | powder to crystal | | color | White to Almost white | | BRN | 1935931 | | InChI | 1S/C16H18/c1-11-5-12(2)8-15(7-11)16-9-13(3)6-14(4)10-16/h5-10H,1-4H3 | | InChIKey | CMZYGFLOKOQMKF-UHFFFAOYSA-N | | SMILES | Cc1cc(cc(c1)c2cc(cc(c2)C)C)C |
| Hazard Codes | Xn,N | | Risk Statements | 22-50/53 | | Safety Statements | 22-24/25-61-60 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 2 | | HS Code | 2902.90.9000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Provider | Language |
|
ALFA
| English |
| | 3,3',5,5'-TETRAMETHYLBIPHENYL Usage And Synthesis |
| Uses | 3,3',5,5'-Tetramethylbiphenyl is used as a precursor for the preparation of 3,3',5,5'-tetramethylenebiphenyl tetraanion. It is also used to prepare biphenyl-3,3',5,5'-tetracarboxylic acid by the oxidation of with potassium permanganate. |
| | 3,3',5,5'-TETRAMETHYLBIPHENYL Preparation Products And Raw materials |
| Raw materials | Borate(1-), tetrakis(3,5-diMethylphenyl)-, sodiuM(1:1)-->1-Iodo-3,5-dimethylbenzene-->2,4-Dimethylbenzoic acid-->3,5-Dimethylphenylboronic acid-->2-(3,5-Dimethylphenyl)-1,3,2-dioxaborinane-->3,5-DIMETHYL-BIPHENYL-->5-Bromo-m-xylene |
|