| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Benzyl-13C6 bromide Basic information |
| Product Name: | Benzyl-13C6 bromide | | Synonyms: | Benzyl Bromide-13C6;Benzyl bromide-(phenyl-13C6)
;Benzyl bromide-(phenyl-13C6);Benzyl-13C6 bromide | | CAS: | 286013-10-3 | | MF: | C7H7Br | | MW: | 176.99 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Benzyl-13C6 bromide Chemical Properties |
| Melting point | -3--1°C (lit.) | | Boiling point | 198-199°C (lit.) | | density | 1.488 g/mL at 25 °C | | solubility | soluble in DCM, Diethyl Ether, Ethyl Acetate, | | form | Oil | | color | Colourless | | InChI | 1S/C7H7Br/c8-6-7-4-2-1-3-5-7/h1-5H,6H2/i1+1,2+1,3+1,4+1,5+1,7+1 | | InChIKey | AGEZXYOZHKGVCM-ZXJNGCBISA-N | | SMILES | BrC[13c]1[13cH][13cH][13cH][13cH][13cH]1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 39 | | WGK Germany | WGK 2 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Benzyl-13C6 bromide Usage And Synthesis |
| Uses | Benzyl Bromide-13C6 is an isotope labelled compound used in organic synthesis for the introduction of the benzyl protecting group for alcohols and carboxylic acids. |
| | Benzyl-13C6 bromide Preparation Products And Raw materials |
|