|
|
| | Sodium 2-aminosulphanilate Basic information |
| Product Name: | Sodium 2-aminosulphanilate | | Synonyms: | 2,4-DIAMINO-BENZENESULFONIC ACID, MONOSODIUM SALT;2,4-DIAMINOBENZENESULPHONATE SODIUM;MPDSA sodium salt;metaPhenylenediamine-4-Sulfonic Acid Sodium Salt;Metaphenylenediamine-4-sulfonicacid,SS;MPDSA,FA;2,4-diamino-benzenesulfonic aci sodium salt;monosodium 2,4-diaminobenzenesulfonate | | CAS: | 3177-22-8 | | MF: | C6H9N2NaO3S | | MW: | 212.2 | | EINECS: | 221-650-3 | | Product Categories: | Intermediates of Dyes and Pigments;bc0001 | | Mol File: | 3177-22-8.mol |  |
| | Sodium 2-aminosulphanilate Chemical Properties |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | InChI | InChI=1S/C6H8N2O3S.Na.H/c7-4-1-2-6(5(8)3-4)12(9,10)11;;/h1-3H,7-8H2,(H,9,10,11);; | | InChIKey | LKJICWJFNGJERX-UHFFFAOYSA-N | | SMILES | S(C1C=CC(N)=CC=1N)(O)(=O)=O.[NaH] | | CAS DataBase Reference | 3177-22-8(CAS DataBase Reference) | | EPA Substance Registry System | Benzenesulfonic acid, 2,4-diamino-, monosodium salt (3177-22-8) |
| | Sodium 2-aminosulphanilate Usage And Synthesis |
| Uses | Sodium 2-aminosulphanilate is used as a solvent for organic synthesis or as a reaction reagent for the preparation of products such as nitrobenzene, sodium sulphite and sulphamic acid. It is also used in the production of dyes, textiles, paper and paints. |
| | Sodium 2-aminosulphanilate Preparation Products And Raw materials |
|