- Z-PYR-OH
-
- $7.00 / 1kg
-
2019-07-06
- CAS: 32159-21-0
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100KG
|
| | Z-PYR-OH Basic information |
| | Z-PYR-OH Chemical Properties |
| Melting point | 128-130°C | | Boiling point | 525.4±50.0 °C(Predicted) | | density | 1.408±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | DMSO (Slightly), Methanol (Sparingly) | | form | Solid | | pka | 3.03±0.20(Predicted) | | color | White | | InChI | InChI=1S/C13H13NO5/c15-11-7-6-10(12(16)17)14(11)13(18)19-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,16,17)/t10-/m0/s1 | | InChIKey | VHSFUGXCSGOKJX-JTQLQIEISA-N | | SMILES | N1(C(OCC2=CC=CC=C2)=O)C(=O)CC[C@H]1C(O)=O | | CAS DataBase Reference | 32159-21-0(CAS DataBase Reference) |
| | Z-PYR-OH Usage And Synthesis |
| Chemical Properties | White Powder | | Uses | Cbz-L-pyroglutamic Acid, is an amino acid building block used in the synthesis of various compounds, such as 5-Oxo-L-prolyl-L-proline (O859055). | | Synthesis | CBZ-L-pyroglutamic acid is an amino acid derivative that can be prepared from L-glutamine by Cbz-Cl protection.
|
| | Z-PYR-OH Preparation Products And Raw materials |
|