|
|
| | 3,5-Bis(trifluoromethyl)benzenethiol Basic information |
| Product Name: | 3,5-Bis(trifluoromethyl)benzenethiol | | Synonyms: | 3,5-Bis(trifluoromethyl)thiophenol 95%;3,5-Bis(trifluoromethyl)thiophenol95%;3,5-BIS(TRIFLUOROMETHYL)THIOPHENOL;3,5-BIS(TRIFLUOROMETHYL)BENZENETHIOL;3,5-bis(trifluoroMethyl)benzene-1-thiol;3,5-Bis(trifluoromethyl)thiophenol,98%;alpha,alpha,alpha,alpha',alpha',alpha'-Hexafluoro-5-thio-m-xylene, 3,5-Bis(trifluoromethyl)phenyl mercaptan;3,5-Bis(trifluoromethyl)benzenethiol 97% | | CAS: | 130783-02-7 | | MF: | C8H4F6S | | MW: | 246.17 | | EINECS: | | | Product Categories: | Building Blocks;Chemical Synthesis;Organic Building Blocks;Sulfur Compounds;Thiols/Mercaptans;Fluorides;Aromatic Phenols | | Mol File: | 130783-02-7.mol |  |
| | 3,5-Bis(trifluoromethyl)benzenethiol Chemical Properties |
| Melting point | 71 °C | | Boiling point | 167 °C (lit.) | | density | 1.46 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.442(lit.) | | Fp | 150 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 4.90±0.11(Predicted) | | form | powder to lump to clear liquid | | color | White or Colorless to Light yellow | | Water Solubility | Insoluble in water but soluble in alcohol and ether. | | Sensitive | Air Sensitive | | InChI | 1S/C8H4F6S/c9-7(10,11)4-1-5(8(12,13)14)3-6(15)2-4/h1-3,15H | | InChIKey | KCAQWPZIMLLEAF-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1cc(S)cc(c1)C(F)(F)F | | CAS DataBase Reference | 130783-02-7(CAS DataBase Reference) | | NIST Chemistry Reference | 3,5-Bis(trifluoromethyl)thiophenol(130783-02-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 3334 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | IRRITANT, AIR SENSITIVE, STENCH | | HazardClass | 6.1 | | HS Code | 29309090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3,5-Bis(trifluoromethyl)benzenethiol Usage And Synthesis |
| Chemical Properties | clear colorless to slightly yellow liquid | | Uses | 3,5-Bis(trifluoromethyl)thiophenol, is an important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field. |
| | 3,5-Bis(trifluoromethyl)benzenethiol Preparation Products And Raw materials |
|