2,5-Dichloro-3-nitrobenzoic acid manufacturers
|
| | 2,5-Dichloro-3-nitrobenzoic acid Basic information |
| Product Name: | 2,5-Dichloro-3-nitrobenzoic acid | | Synonyms: | 2,5-dichloro-3-nitrobenzoic;TIMTEC-BB SBB003246;2,5-DICHLORO-3-NITROBENZOIC ACID;DINOBEN;DINOBEN:2,5-DICHLORO-3-NITROBENZOIC ACID;3-nitro-2,5-dichlorobenzoic acid;2,5-Dichloro-3-nitrobenzoic acid, 98+%;2,5-Dichloro-3-nitro | | CAS: | 88-86-8 | | MF: | C7H3Cl2NO4 | | MW: | 236.01 | | EINECS: | 201-862-2 | | Product Categories: | Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Benzoic acid;C7;Carbonyl Compounds;Carboxylic Acids | | Mol File: | 88-86-8.mol |  |
| | 2,5-Dichloro-3-nitrobenzoic acid Chemical Properties |
| Melting point | 216-220 °C (lit.) | | Boiling point | 366.5±42.0 °C(Predicted) | | density | 1.713±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 1.56±0.20(Predicted) | | Appearance | White to light yellow Solid | | BRN | 1976119 | | InChI | 1S/C7H3Cl2NO4/c8-3-1-4(7(11)12)6(9)5(2-3)10(13)14/h1-2H,(H,11,12) | | InChIKey | AUAXYMOBWXOEQD-UHFFFAOYSA-N | | SMILES | OC(=O)c1cc(Cl)cc(c1Cl)[N+]([O-])=O | | CAS DataBase Reference | 88-86-8(CAS DataBase Reference) | | EPA Substance Registry System | 2,5-Dichloro-3-nitrobenzoic acid (88-86-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 2 | | RTECS | DG7875000 | | HazardClass | IRRITANT | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,5-Dichloro-3-nitrobenzoic acid Usage And Synthesis |
| Uses | 2,5-Dichloro-3-nitrobenzoic Acid is used in process for the preparation of organic halides. | | General Description | Effect of 2,5-dichloro-3-nitrobenzoic acid on growth and on polar auxin transport has been studied. |
| | 2,5-Dichloro-3-nitrobenzoic acid Preparation Products And Raw materials |
|