|
|
| | Ac-DNLD-CHO Basic information |
| Product Name: | Ac-DNLD-CHO | | Synonyms: | CASPASE-3/7 INHIBITOR II;AC-ASP-ASN-LEU-ASP-H (ALDEHYDE);ACETYL-L-ASPARTYL-L-ASPARAGINYL-L-LEUCYL-L-ASPART-1-AL;Ac-Asp-Asn-Leu-Asp-aldehyde (pseudo acid);Ac-Asp-Asn-Leu-Asp-CHO;Caspase-3/7 Inhibitor II - CAS 775289-20-8 - Calbiochem;Caspase-3/7 Inhibitor II Ac-Asp-Asn-Leu-Asp-aldehyde (pseudo acid);L-Leucinamide, N-acetyl-L-α-aspartyl-L-asparaginyl-N-[(1S)-2-carboxy-1-formylethyl]- | | CAS: | 775289-20-8 | | MF: | C20H31N5O10 | | MW: | 501.49 | | EINECS: | | | Product Categories: | peptides | | Mol File: | Mol File |  |
| | Ac-DNLD-CHO Chemical Properties |
| Boiling point | 1034.0±65.0 °C(Predicted) | | density | 1.349±0.06 g/cm3(Predicted) | | storage temp. | -20C | | solubility | water: 1 mg/mL || DMSO: 5 mg/mL | | form | White solid | | pka | 4.20±0.10(Predicted) | | color | white | | Water Solubility | water: 1mg/mL
DMSO: 5mg/mL | | Sequence | Ac-Asp-Asn-Leu-Asp-CHO | | InChIKey | XZGUQURUQBIHMG-XUXIUFHCSA-N | | SMILES | N([C@@H](CC(C)C)C(=O)N[C@@H](CC(=O)O)C=O)C(=O)[C@@H](NC(=O)[C@@H](NC(=O)C)CC(=O)O)CC(=O)N |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | Ac-DNLD-CHO Usage And Synthesis |
| Uses | Ac-DNLD-CHO (Ac-Asp-Asn-Leu-Asp-CHO) is a Caspase-3/7 inhibitor (IC50: 9.89, 245 nM respectively; Kiapp: 0.68, 55.7 nM respectively). Ac-DNLD-CHO can be used for research of caspase-mediated apoptosis diseases, such as neurodegenerative disorders and viral infection diseases[1]. | | Biological Activity | Cell permeable: no', 'Primary Target
caspase-3, caspase-7', 'Product does not compete with ATP.', 'Reversible: yes', 'Target IC50: 3.2 nM and 22.6 nM, against caspases-3 and -7, respectively | | References | [1] Yoshimori A, et al. Structural and functional definition of the specificity of a novel caspase-3 inhibitor, Ac-DNLD-CHO. BMC Pharmacol. 2007 Jun 27;7:8. DOI:10.1186/1471-2210-7-8 |
| | Ac-DNLD-CHO Preparation Products And Raw materials |
|