|
|
| | 3-(N-Phenyl-N-methyl)aminoacrolein Basic information |
| Product Name: | 3-(N-Phenyl-N-methyl)aminoacrolein | | Synonyms: | 3-(N-PHENYL-N-METHYL)AMINOACROLEIN;3-N-METHYL-N-PHENYLAMINOACROLEIN;3-AMINO-N-METHYL-N-PHENYLACROLEIN;3-N-METHYL-N-PHENYLAMINOACROLEINI;3-(methyl(phenyl)amino)acrylaldehyde;N-Methyl-N-phenyl-3-aMinoacrolein;2-Propenal,3-(methylphenylamino)-;(Z)-3-(N-methylanilino)prop-2-enal | | CAS: | 14189-82-3 | | MF: | C10H11NO | | MW: | 161.2 | | EINECS: | 604-260-1 | | Product Categories: | Fluvastatin;Fluvastatine | | Mol File: | 14189-82-3.mol |  |
| | 3-(N-Phenyl-N-methyl)aminoacrolein Chemical Properties |
| Melting point | 166 °C (decomp) | | Boiling point | 144-145 °C(Press: 0.8 Torr) | | density | 1.064±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Very Slightly) | | form | Solid | | pka | 1.07±0.70(Predicted) | | color | Pale Brown to Brown | | Stability: | Air Sensitive | | InChI | InChI=1S/C10H11NO/c1-11(8-5-9-12)10-6-3-2-4-7-10/h2-9H,1H3 | | InChIKey | YLMOTKLYENPQLK-UHFFFAOYSA-N | | SMILES | C(=O)C=CN(C)C1=CC=CC=C1 | | CAS DataBase Reference | 14189-82-3(CAS DataBase Reference) |
| | 3-(N-Phenyl-N-methyl)aminoacrolein Usage And Synthesis |
| | 3-(N-Phenyl-N-methyl)aminoacrolein Preparation Products And Raw materials |
|