| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Company Name: |
ChemeGen |
| Tel: |
18818260767 |
| Email: |
2625930290@qq.com |
|
| | 2-Acetyl-3,5-dihydroxyphenylacetic acid Basic information |
| | 2-Acetyl-3,5-dihydroxyphenylacetic acid Chemical Properties |
| Boiling point | 466.4±24.0 °C(Predicted) | | density | 1.446±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO: soluble; Methanol: soluble | | form | A solid | | pka | 3.96±0.10(Predicted) | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C10H10O5/c1-5(11)10-6(3-9(14)15)2-7(12)4-8(10)13/h2,4,12-13H,3H2,1H3,(H,14,15) | | InChIKey | JAHPPWGWEUVLMS-UHFFFAOYSA-N | | SMILES | O=C(C1=C(C=C(C=C1O)O)CC(O)=O)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-Acetyl-3,5-dihydroxyphenylacetic acid Usage And Synthesis |
| Description | Curvulinic acid is a fungal metabolite originally isolated from C. siddiqui. It inhibits C. bursa-pastoris seed germination, root growth, and shoot growth by 73.3, 73.5, and 66.7%, respectively, when used at a concentration of 600 μg/ml. | | Uses | Curvulinic acid is a phytotoxic compound, has herbicidal activity[1]. | | Definition | ChEBI: 2-(2-acetyl-3,5-dihydroxyphenyl)acetic acid is an aromatic ketone. | | References | [1] Jun Li, et al.Herbicidal activity of curvuiinic acid isolated from Nimbya alternantherae.Nat Prod Commun. 2012 Jan;7(1):51-2. PMID:22428243 |
| | 2-Acetyl-3,5-dihydroxyphenylacetic acid Preparation Products And Raw materials |
|