|
|
| | Inosine-5'-diphosphoric acid disodium salt Basic information |
| Product Name: | Inosine-5'-diphosphoric acid disodium salt | | Synonyms: | IDP.Na2;5′-IDP,2Na;Inosine-5'-diphosphorica.;IDP DISODIUM SALT;Inosine 5'-(trihydrogen diphosphate), disodium salt;5'-Idp-Na2;INOSINE-5''-DIPHOSPHATE, DISODIUM SALT(IDP.NA2);INOSINE-5''-DIPHOSPHORIC ACID DISODIUM SALT | | CAS: | 54735-61-4 | | MF: | C10H15N4NaO11P2 | | MW: | 452.18 | | EINECS: | 259-312-2 | | Product Categories: | Material;API | | Mol File: | 54735-61-4.mol |  |
| | Inosine-5'-diphosphoric acid disodium salt Chemical Properties |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | Powder | | InChIKey | OEDHQWCLGCCECJ-JHVGCDEENA-N | | SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(O)=O)O[C@H]1N1C=NC2C(NC=NC1=2)=O)O.[NaH] |&1:1,2,3,15,r| | | CAS DataBase Reference | 54735-61-4(CAS DataBase Reference) |
| | Inosine-5'-diphosphoric acid disodium salt Usage And Synthesis |
| Description | Inosine-5'-diphosphoric acid disodium salt (IDP-Na2), a pivotal biochemical compound
sought after in the biomedical industry, assumes an indispensable
function in the generation and modulation of intracellular signaling
molecules. Given its implication in cellular energy metabolism and
nucleotide biosynthesis, this particular product finds application in
ameliorating distinct metabolic disorders and neurodegenerative
ailments. | | Uses | Inosine-5'-diphosphoric acid disodium salt (IDP-Na2) is a purine nucleotide salt compound, mostly used in the field of biochemistry and enzymology in the study of metabolism and regulation of intracellular nucleotides. It has been shown to have antimicrobial activity and can be used in the synthesis of antimicrobial drugs. It is also used in the production of polymers and as a precursor for other organic compounds. |
| | Inosine-5'-diphosphoric acid disodium salt Preparation Products And Raw materials |
|