|
|
| | 2-Bromo-5-chlorothiazole Basic information |
| Product Name: | 2-Bromo-5-chlorothiazole | | Synonyms: | 2-Bromo-5-chlorothiazole;Thiazole, 2-bromo-5-chloro-;2-broMo-5-chloro-1,3-thiazole;2-Bromo-5-chlorothiazole,97% | | CAS: | 16629-15-5 | | MF: | C3HBrClNS | | MW: | 198.47 | | EINECS: | 205-525-8 | | Product Categories: | | | Mol File: | 16629-15-5.mol |  |
| | 2-Bromo-5-chlorothiazole Chemical Properties |
| Boiling point | 216.7±13.0 °C(Predicted) | | density | 1.979±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | -0.88±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C3HBrClNS/c4-3-6-1-2(5)7-3/h1H | | InChIKey | FYKOEXGDJNPHQV-UHFFFAOYSA-N | | SMILES | S1C(Cl)=CN=C1Br |
| | 2-Bromo-5-chlorothiazole Usage And Synthesis |
| | 2-Bromo-5-chlorothiazole Preparation Products And Raw materials |
|