| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
2-Methyl-2H-indazole-4-boronic acid pinacol ester manufacturers
|
| | 2-Methyl-2H-indazole-4-boronic acid pinacol ester Basic information |
| Product Name: | 2-Methyl-2H-indazole-4-boronic acid pinacol ester | | Synonyms: | 2-Methyl-2H-indazole-4-boronic acid pinacol ester;2-Methylindazole-4-boronic acid pinacol ester;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole;2-Methylindazole-4-boroni...;2-Methyl-4-(tetraMethyl-1,3,2-dioxaborolan-2-yl)-2H-indazole;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole;2H-Indazole, 2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;2-Methyl-2H-indazole-4-boronic acid pinacol ester | | CAS: | 885698-95-3 | | MF: | C14H19BN2O2 | | MW: | 258.12 | | EINECS: | | | Product Categories: | Indazole;Organoborons | | Mol File: | 885698-95-3.mol |  |
| | 2-Methyl-2H-indazole-4-boronic acid pinacol ester Chemical Properties |
| Boiling point | 404.4±18.0 °C(Predicted) | | density | 1.11±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 1.03±0.30(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C14H19BN2O2/c1-13(2)14(3,4)19-15(18-13)11-7-6-8-12-10(11)9-17(5)16-12/h6-9H,1-5H3 | | InChIKey | YQMBOMPXHDRRIM-UHFFFAOYSA-N | | SMILES | N1=C2C(C(B3OC(C)(C)C(C)(C)O3)=CC=C2)=CN1C |
| HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids |
| | 2-Methyl-2H-indazole-4-boronic acid pinacol ester Usage And Synthesis |
| | 2-Methyl-2H-indazole-4-boronic acid pinacol ester Preparation Products And Raw materials |
|