|
|
| | 2-(3-Chlorophenyl)-2-methylpropanoic acid Basic information |
| | 2-(3-Chlorophenyl)-2-methylpropanoic acid Chemical Properties |
| Boiling point | 292.9±15.0 °C(Predicted) | | density | 1.220±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 4.22±0.10(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C10H11ClO2/c1-10(2,9(12)13)7-4-3-5-8(11)6-7/h3-6H,1-2H3,(H,12,13) | | InChIKey | SFXNGYPSARMRKU-UHFFFAOYSA-N | | SMILES | O=C(O)C(C)(C)C1=CC=CC(Cl)=C1 |
| WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2918999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 2-(3-Chlorophenyl)-2-methylpropanoic acid Usage And Synthesis |
| | 2-(3-Chlorophenyl)-2-methylpropanoic acid Preparation Products And Raw materials |
|